4,7-Dihydroxy-2,3-methylenedioxy-9,10-dihydro-phenanthrene
| Internal ID | 9ed220b0-9747-4107-abe8-6cfd44c32ad9 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives |
| IUPAC Name | 5,6-dihydronaphtho[2,1-f][1,3]benzodioxole-3,11-diol |
| SMILES (Canonical) | C1CC2=C(C=CC(=C2)O)C3=C(C4=C(C=C31)OCO4)O |
| SMILES (Isomeric) | C1CC2=C(C=CC(=C2)O)C3=C(C4=C(C=C31)OCO4)O |
| InChI | InChI=1S/C15H12O4/c16-10-3-4-11-8(5-10)1-2-9-6-12-15(19-7-18-12)14(17)13(9)11/h3-6,16-17H,1-2,7H2 |
| InChI Key | QPSCKIQSZZPZQX-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.07355886 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.30% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.66% | 91.49% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 96.84% | 98.35% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 93.02% | 82.67% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.38% | 98.95% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.58% | 93.40% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.37% | 86.33% |
| CHEMBL5145 | P15056 | Serine/threonine-protein kinase B-raf | 85.93% | 97.90% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.88% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.53% | 90.00% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.96% | 95.78% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.80% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.04% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.31% | 89.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.76% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bulbophyllum andersonii |
| PubChem | 15081425 |
| LOTUS | LTS0102718 |
| wikiData | Q105225566 |