4,7-Dibromo-9,10-dihydrophenanthrene-2,3,5,6-tetraol
| Internal ID | 77be80e9-126f-4340-9152-22bc16088b78 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
| IUPAC Name | 4,7-dibromo-9,10-dihydrophenanthrene-2,3,5,6-tetrol |
| SMILES (Canonical) | C1CC2=CC(=C(C(=C2C3=C(C(=C(C=C31)O)O)Br)O)O)Br |
| SMILES (Isomeric) | C1CC2=CC(=C(C(=C2C3=C(C(=C(C=C31)O)O)Br)O)O)Br |
| InChI | InChI=1S/C14H10Br2O4/c15-7-3-5-1-2-6-4-8(17)13(19)11(16)9(6)10(5)14(20)12(7)18/h3-4,17-20H,1-2H2 |
| InChI Key | SSPNVSUGGPBPEK-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C14H10Br2O4 |
| Molecular Weight | 402.03 g/mol |
| Exact Mass | 401.89253 g/mol |
| Topological Polar Surface Area (TPSA) | 80.90 Ų |
| XlogP | 3.80 |
| 4,7-dibromo-9,10-dihydrophenanthrene-2,3,5,6-tetraol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.46% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.58% | 93.99% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.05% | 94.45% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 86.26% | 98.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.12% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.41% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.35% | 90.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.33% | 91.49% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.23% | 93.40% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 81.56% | 80.00% |
| CHEMBL5145 | P15056 | Serine/threonine-protein kinase B-raf | 81.33% | 97.90% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.29% | 93.18% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.13% | 99.15% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.84% | 92.94% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.58% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 24770034 |
| LOTUS | LTS0071985 |
| wikiData | Q105259815 |