[2-[5-Acetyloxy-3-hydroxy-2-(2-hydroxy-3-methyl-6-propan-2-ylphenoxy)-6-methyloxan-4-yl]oxy-3,5-dihydroxy-6-methyloxan-4-yl] 2-methylbut-2-enoate
| Internal ID | 03179076-b11d-4c84-8906-f8e9d211b946 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
| IUPAC Name | [2-[5-acetyloxy-3-hydroxy-2-(2-hydroxy-3-methyl-6-propan-2-ylphenoxy)-6-methyloxan-4-yl]oxy-3,5-dihydroxy-6-methyloxan-4-yl] 2-methylbut-2-enoate |
| SMILES (Canonical) | CC=C(C)C(=O)OC1C(C(OC(C1O)OC2C(C(OC(C2OC(=O)C)C)OC3=C(C=CC(=C3O)C)C(C)C)O)C)O |
| SMILES (Isomeric) | CC=C(C)C(=O)OC1C(C(OC(C1O)OC2C(C(OC(C2OC(=O)C)C)OC3=C(C=CC(=C3O)C)C(C)C)O)C)O |
| InChI | InChI=1S/C29H42O12/c1-9-13(4)27(35)39-25-20(32)15(6)36-28(21(25)33)41-26-22(34)29(37-16(7)23(26)38-17(8)30)40-24-18(12(2)3)11-10-14(5)19(24)31/h9-12,15-16,20-23,25-26,28-29,31-34H,1-8H3 |
| InChI Key | OMTIAXMAFZGJDY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C29H42O12 |
| Molecular Weight | 582.60 g/mol |
| Exact Mass | 582.26762677 g/mol |
| Topological Polar Surface Area (TPSA) | 170.00 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of [2-[5-Acetyloxy-3-hydroxy-2-(2-hydroxy-3-methyl-6-propan-2-ylphenoxy)-6-methyloxan-4-yl]oxy-3,5-dihydroxy-6-methyloxan-4-yl] 2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/46de8530-85fb-11ee-9e5d-43568e9d0bd5.jpg "2D Structure of [2-[5-Acetyloxy-3-hydroxy-2-(2-hydroxy-3-methyl-6-propan-2-ylphenoxy)-6-methyloxan-4-yl]oxy-3,5-dihydroxy-6-methyloxan-4-yl] 2-methylbut-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.80% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.41% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.27% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 95.09% | 94.73% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.35% | 93.56% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.02% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.31% | 96.00% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 88.91% | 95.64% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.92% | 94.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.30% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.04% | 99.15% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.11% | 97.21% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.53% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.18% | 99.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.66% | 99.23% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.16% | 93.65% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.58% | 90.71% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 80.47% | 89.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Melampodium divaricatum |
| PubChem | 163017686 |
| LOTUS | LTS0256893 |
| wikiData | Q105194501 |