2-[(1R,2S,4aS,6S,8aR)-2-acetyl-6-ethenyl-2,6,8a-trimethyl-3,4,4a,5,7,8-hexahydro-1H-naphthalen-1-yl]acetic acid
| Internal ID | dd4c58a6-6373-43fa-8240-e6f50f38b1e4 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 2-[(1R,2S,4aS,6S,8aR)-2-acetyl-6-ethenyl-2,6,8a-trimethyl-3,4,4a,5,7,8-hexahydro-1H-naphthalen-1-yl]acetic acid |
| SMILES (Canonical) | CC(=O)C1(CCC2CC(CCC2(C1CC(=O)O)C)(C)C=C)C |
| SMILES (Isomeric) | CC(=O)[C@]1(CC[C@H]2C[C@@](CC[C@]2([C@H]1CC(=O)O)C)(C)C=C)C |
| InChI | InChI=1S/C19H30O3/c1-6-17(3)9-10-19(5)14(12-17)7-8-18(4,13(2)20)15(19)11-16(21)22/h6,14-15H,1,7-12H2,2-5H3,(H,21,22)/t14-,15-,17-,18+,19+/m0/s1 |
| InChI Key | ZWZOZRNYABZXCN-WAARBJQMSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.21949481 g/mol |
| Topological Polar Surface Area (TPSA) | 54.40 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
![2D Structure of 2-[(1R,2S,4aS,6S,8aR)-2-acetyl-6-ethenyl-2,6,8a-trimethyl-3,4,4a,5,7,8-hexahydro-1H-naphthalen-1-yl]acetic acid](https://plantaedb.com/storage/docs/compounds/2023/11/469eb550-8716-11ee-b771-19508b1fcdce.jpg "2D Structure of 2-[(1R,2S,4aS,6S,8aR)-2-acetyl-6-ethenyl-2,6,8a-trimethyl-3,4,4a,5,7,8-hexahydro-1H-naphthalen-1-yl]acetic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.95% | 96.09% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.40% | 93.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.81% | 90.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.77% | 91.19% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.49% | 91.11% |
| CHEMBL5028 | O14672 | ADAM10 | 85.84% | 97.50% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.35% | 97.25% |
| CHEMBL203 | P00533 | Epidermal growth factor receptor erbB1 | 83.69% | 97.34% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.54% | 100.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.79% | 95.50% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.81% | 98.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.39% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ceriops tagal |
| PubChem | 162892599 |
| LOTUS | LTS0104353 |
| wikiData | Q105385350 |