(2S)-1-[(2S)-2-[[(2S,3R)-2-[[(2R,3R)-3-amino-10-chloro-2-hydroxydecanoyl]amino]-3-methylpentanoyl]-methylamino]-4-methylpentanoyl]pyrrolidine-2-carboxylic acid
| Internal ID | 86a57ebe-3810-4da8-9e3b-c6ff6e798dd8 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | (2S)-1-[(2S)-2-[[(2S,3R)-2-[[(2R,3R)-3-amino-10-chloro-2-hydroxydecanoyl]amino]-3-methylpentanoyl]-methylamino]-4-methylpentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES (Canonical) | CCC(C)C(C(=O)N(C)C(CC(C)C)C(=O)N1CCCC1C(=O)O)NC(=O)C(C(CCCCCCCCl)N)O |
| SMILES (Isomeric) | CC[C@@H](C)[C@@H](C(=O)N(C)[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)O)NC(=O)[C@@H]([C@@H](CCCCCCCCl)N)O |
| InChI | InChI=1S/C28H51ClN4O6/c1-6-19(4)23(31-25(35)24(34)20(30)13-10-8-7-9-11-15-29)27(37)32(5)22(17-18(2)3)26(36)33-16-12-14-21(33)28(38)39/h18-24,34H,6-17,30H2,1-5H3,(H,31,35)(H,38,39)/t19-,20-,21+,22+,23+,24-/m1/s1 |
| InChI Key | MECPYWUIDGLDCB-PEOLYXCJSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H51ClN4O6 |
| Molecular Weight | 575.20 g/mol |
| Exact Mass | 574.3497131 g/mol |
| Topological Polar Surface Area (TPSA) | 153.00 Ų |
| XlogP | 1.50 |
| Atomic LogP (AlogP) | 2.73 |
| H-Bond Acceptor | 6 |
| H-Bond Donor | 4 |
| Rotatable Bonds | 18 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6197 | 61.97% |
| Caco-2 | - | 0.7982 | 79.82% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.5571 | 55.71% |
| Subcellular localzation | Mitochondria | 0.4457 | 44.57% |
| OATP2B1 inhibitior | - | 0.5674 | 56.74% |
| OATP1B1 inhibitior | + | 0.9009 | 90.09% |
| OATP1B3 inhibitior | + | 0.9273 | 92.73% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 0.8750 | 87.50% |
| BSEP inhibitior | - | 0.6657 | 66.57% |
| P-glycoprotein inhibitior | + | 0.5937 | 59.37% |
| P-glycoprotein substrate | + | 0.7963 | 79.63% |
| CYP3A4 substrate | + | 0.6926 | 69.26% |
| CYP2C9 substrate | - | 0.6000 | 60.00% |
| CYP2D6 substrate | - | 0.8016 | 80.16% |
| CYP3A4 inhibition | - | 0.7424 | 74.24% |
| CYP2C9 inhibition | - | 0.8530 | 85.30% |
| CYP2C19 inhibition | - | 0.7875 | 78.75% |
| CYP2D6 inhibition | - | 0.9000 | 90.00% |
| CYP1A2 inhibition | - | 0.8409 | 84.09% |
| CYP2C8 inhibition | - | 0.6664 | 66.64% |
| CYP inhibitory promiscuity | - | 0.9616 | 96.16% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.8000 | 80.00% |
| Carcinogenicity (trinary) | Non-required | 0.6074 | 60.74% |
| Eye corrosion | - | 0.9832 | 98.32% |
| Eye irritation | - | 0.9313 | 93.13% |
| Skin irritation | - | 0.7716 | 77.16% |
| Skin corrosion | - | 0.9091 | 90.91% |
| Ames mutagenesis | - | 0.5900 | 59.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4731 | 47.31% |
| Micronuclear | + | 0.7900 | 79.00% |
| Hepatotoxicity | + | 0.6175 | 61.75% |
| skin sensitisation | - | 0.8653 | 86.53% |
| Respiratory toxicity | + | 0.8222 | 82.22% |
| Reproductive toxicity | + | 0.8222 | 82.22% |
| Mitochondrial toxicity | + | 0.7625 | 76.25% |
| Nephrotoxicity | - | 0.7929 | 79.29% |
| Acute Oral Toxicity (c) | III | 0.6304 | 63.04% |
| Estrogen receptor binding | + | 0.6376 | 63.76% |
| Androgen receptor binding | + | 0.5907 | 59.07% |
| Thyroid receptor binding | - | 0.5000 | 50.00% |
| Glucocorticoid receptor binding | + | 0.6034 | 60.34% |
| Aromatase binding | + | 0.5541 | 55.41% |
| PPAR gamma | + | 0.5646 | 56.46% |
| Honey bee toxicity | - | 0.8763 | 87.63% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.6128 | 61.28% |
| Fish aquatic toxicity | + | 0.7718 | 77.18% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.21% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 98.94% | 96.61% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.94% | 96.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.47% | 89.63% |
| CHEMBL204 | P00734 | Thrombin | 98.12% | 96.01% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 97.23% | 98.10% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 97.21% | 100.00% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 96.73% | 91.76% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 96.39% | 98.33% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.15% | 93.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 96.03% | 96.47% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 95.01% | 94.66% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 94.86% | 92.86% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 94.50% | 97.86% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.14% | 83.82% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 93.87% | 98.24% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 93.71% | 96.38% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 93.61% | 95.52% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 93.44% | 97.50% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.23% | 90.71% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 92.47% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.23% | 91.19% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.64% | 90.17% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 90.63% | 97.29% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.59% | 99.17% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 90.15% | 94.50% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.72% | 97.29% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 89.37% | 98.77% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 89.08% | 97.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 88.81% | 94.33% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 88.20% | 90.24% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 88.10% | 92.12% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.04% | 93.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.76% | 100.00% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 87.57% | 99.18% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 87.56% | 97.47% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 87.51% | 97.64% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.50% | 97.25% |
| CHEMBL268 | P43235 | Cathepsin K | 87.36% | 96.85% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 87.24% | 95.71% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 87.12% | 96.03% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 86.70% | 97.43% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.50% | 95.17% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.08% | 91.03% |
| CHEMBL3691 | Q13822 | Autotaxin | 85.88% | 96.39% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.41% | 95.89% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 85.27% | 95.34% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.89% | 95.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.74% | 97.09% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.48% | 95.89% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 84.20% | 95.36% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 84.14% | 100.00% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 83.95% | 97.56% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 83.28% | 96.76% |
| CHEMBL4072 | P07858 | Cathepsin B | 83.23% | 93.67% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.07% | 90.08% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.68% | 93.18% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.85% | 95.56% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.72% | 96.95% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 81.28% | 95.69% |
| CHEMBL238 | Q01959 | Dopamine transporter | 81.11% | 95.88% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.03% | 96.37% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 80.53% | 96.67% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.03% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163013806 |
| LOTUS | LTS0005538 |
| wikiData | Q105162136 |