4,6,9-Trimethyl-5,6,7,8-tetrahydrophenanthrene-1,2-diol
| Internal ID | 6ce21c83-3667-4206-a9fd-8184280681c9 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 4,6,9-trimethyl-5,6,7,8-tetrahydrophenanthrene-1,2-diol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H20O2/c1-9-4-5-12-10(2)7-14-16(13(12)6-9)11(3)8-15(18)17(14)19/h7-9,18-19H,4-6H2,1-3H3 |
| InChI Key | SBKZSFKINYBDQT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.146329876 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 4.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.01% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.95% | 91.49% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.74% | 93.40% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.43% | 92.94% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 90.60% | 95.62% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 90.02% | 95.70% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.18% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.96% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.75% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.21% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.92% | 96.09% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 83.86% | 91.79% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 82.99% | 88.48% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 82.75% | 98.11% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.21% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.76% | 98.95% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 80.10% | 97.23% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.00% | 86.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Chloranthus henryi |
| PubChem | 163039244 |
| LOTUS | LTS0074242 |
| wikiData | Q105249520 |