4,6,8-trimethoxy-1H-quinolin-2-one
| Internal ID | c5ab6271-4f53-463d-8c1a-27da8459a29e |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Hydroquinolones |
| IUPAC Name | 4,6,8-trimethoxy-1H-quinolin-2-one |
| SMILES (Canonical) | COC1=CC2=C(C(=C1)OC)NC(=O)C=C2OC |
| SMILES (Isomeric) | COC1=CC2=C(C(=C1)OC)NC(=O)C=C2OC |
| InChI | InChI=1S/C12H13NO4/c1-15-7-4-8-9(16-2)6-11(14)13-12(8)10(5-7)17-3/h4-6H,1-3H3,(H,13,14) |
| InChI Key | TWZNHNBGZBKUJJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08445790 g/mol |
| Topological Polar Surface Area (TPSA) | 56.80 Ų |
| XlogP | 1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.56% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.01% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.96% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.77% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.18% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.64% | 94.45% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.26% | 94.80% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.19% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.00% | 85.14% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 85.72% | 98.59% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 83.99% | 95.56% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.52% | 93.31% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 81.64% | 92.38% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.29% | 93.99% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.33% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Agathosma bisulca |
| Halfordia kendack |
| PubChem | 15559611 |
| LOTUS | LTS0191691 |
| wikiData | Q105266278 |