(2R,3R,4S,5S,6R)-2-[(1S,4R,5S)-4-[(3S)-3-hydroxybutyl]-5-(hydroxymethyl)-3,3-dimethylcyclohexyl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
| Internal ID | c04071e9-42b0-4fff-a46f-ec14e9eeb2fc |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(1S,4R,5S)-4-[(3S)-3-hydroxybutyl]-5-(hydroxymethyl)-3,3-dimethylcyclohexyl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES (Canonical) | CC(CCC1C(CC(CC1(C)C)OC2C(C(C(C(O2)CO)O)O)O)CO)O |
| SMILES (Isomeric) | C[C@@H](CC[C@@H]1[C@H](C[C@@H](CC1(C)C)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)CO)O |
| InChI | InChI=1S/C19H36O8/c1-10(22)4-5-13-11(8-20)6-12(7-19(13,2)3)26-18-17(25)16(24)15(23)14(9-21)27-18/h10-18,20-25H,4-9H2,1-3H3/t10-,11+,12-,13+,14+,15+,16-,17+,18+/m0/s1 |
| InChI Key | CJUHYIMRYOMZHW-PZKIOYHUSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H36O8 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.24101810 g/mol |
| Topological Polar Surface Area (TPSA) | 140.00 Ų |
| XlogP | 0.00 |
| There are no found synonyms. |
![2D Structure of (2R,3R,4S,5S,6R)-2-[(1S,4R,5S)-4-[(3S)-3-hydroxybutyl]-5-(hydroxymethyl)-3,3-dimethylcyclohexyl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/46553510-8514-11ee-adc7-e924012efa30.jpg "2D Structure of (2R,3R,4S,5S,6R)-2-[(1S,4R,5S)-4-[(3S)-3-hydroxybutyl]-5-(hydroxymethyl)-3,3-dimethylcyclohexyl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.90% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.38% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.47% | 97.25% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.92% | 96.61% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.71% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.01% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.76% | 85.14% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 91.05% | 97.79% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.10% | 96.47% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.99% | 92.86% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.34% | 98.95% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.06% | 96.21% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.47% | 86.92% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.89% | 95.50% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 84.68% | 85.31% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 82.88% | 98.10% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.08% | 95.89% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.73% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Melia azedarach |
| PubChem | 21636349 |
| LOTUS | LTS0078061 |
| wikiData | Q104961708 |