[4-[3,4-Dihydroxy-6-methyl-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate
| Internal ID | 650449ba-bef2-4a04-8fc2-4bc6915207e4 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
| IUPAC Name | [4-[3,4-dihydroxy-6-methyl-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C=CC3=CC(=C(C=C3)O)O)CO)O)O)O)O)OC4C(C(C(C(O4)CO)O)O)O |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C=CC3=CC(=C(C=C3)O)O)CO)O)O)O)O)OC4C(C(C(C(O4)CO)O)O)O |
| InChI | InChI=1S/C27H38O18/c1-9-22(44-27-19(36)17(34)16(33)13(7-28)42-27)18(35)20(37)26(40-9)45-24-21(38)25(39)41-14(8-29)23(24)43-15(32)5-3-10-2-4-11(30)12(31)6-10/h2-6,9,13-14,16-31,33-39H,7-8H2,1H3 |
| InChI Key | PVQWEYQPJCMWQF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C27H38O18 |
| Molecular Weight | 650.60 g/mol |
| Exact Mass | 650.20581436 g/mol |
| Topological Polar Surface Area (TPSA) | 295.00 Ų |
| XlogP | -3.90 |
| There are no found synonyms. |
![2D Structure of [4-[3,4-Dihydroxy-6-methyl-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/463ddc40-8666-11ee-a227-17e1e2918db5.jpg "2D Structure of [4-[3,4-Dihydroxy-6-methyl-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.80% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.69% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.37% | 96.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.08% | 89.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.04% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.76% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.91% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.19% | 99.17% |
| CHEMBL3194 | P02766 | Transthyretin | 89.84% | 90.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.50% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.61% | 95.56% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 86.33% | 97.36% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.87% | 90.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 83.53% | 95.93% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.68% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Boschniakia rossica |
| PubChem | 162898824 |
| LOTUS | LTS0227964 |
| wikiData | Q105215564 |