(4E,6E)-7-[(2S,3R,4bS,5'R,6R,7R,8S,8aR,10aR)-6-acetyloxy-8-hydroxy-5'-(hydroxymethyl)-4a,7-dimethyl-2',4,4'-trioxospiro[2,4b,5,6,7,8,8a,10a-octahydro-1H-phenanthrene-3,3'-oxolane]-2-yl]hepta-2,4,6-trienoic acid
| Internal ID | e295ad8e-5b34-4f41-bd9d-25bcd8685792 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives |
| IUPAC Name | (4E,6E)-7-[(2S,3R,4bS,5'R,6R,7R,8S,8aR,10aR)-6-acetyloxy-8-hydroxy-5'-(hydroxymethyl)-4a,7-dimethyl-2',4,4'-trioxospiro[2,4b,5,6,7,8,8a,10a-octahydro-1H-phenanthrene-3,3'-oxolane]-2-yl]hepta-2,4,6-trienoic acid |
| SMILES (Canonical) | CC1C(CC2C(C1O)C=CC3C2(C(=O)C4(C(C3)C=CC=CC=CC(=O)O)C(=O)C(OC4=O)CO)C)OC(=O)C |
| SMILES (Isomeric) | C[C@H]1[C@@H](C[C@H]2[C@H]([C@@H]1O)C=C[C@@H]3C2(C(=O)[C@]4([C@@H](C3)/C=C/C=C/C=CC(=O)O)C(=O)[C@H](OC4=O)CO)C)OC(=O)C |
| InChI | InChI=1S/C29H34O10/c1-15-21(38-16(2)31)13-20-19(24(15)34)11-10-17-12-18(8-6-4-5-7-9-23(32)33)29(26(36)28(17,20)3)25(35)22(14-30)39-27(29)37/h4-11,15,17-22,24,30,34H,12-14H2,1-3H3,(H,32,33)/b5-4+,8-6+,9-7?/t15-,17-,18+,19+,20-,21+,22+,24+,28?,29-/m0/s1 |
| InChI Key | UNCBZODCSVGKDO-SZSKQHKESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C29H34O10 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.21519728 g/mol |
| Topological Polar Surface Area (TPSA) | 165.00 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.97% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.05% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.49% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.70% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.08% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.90% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.26% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.11% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.40% | 99.17% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.88% | 100.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.73% | 91.07% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.08% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163187256 |
| LOTUS | LTS0215431 |
| wikiData | Q105275899 |