4,6-Dimethoxyphenanthrene-2,3,7-triol
| Internal ID | 9bfa45cb-3089-457a-979f-2f046bb40b8c |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthrols |
| IUPAC Name | 4,6-dimethoxyphenanthrene-2,3,7-triol |
| SMILES (Canonical) | COC1=C(C=C2C=CC3=CC(=C(C(=C3C2=C1)OC)O)O)O |
| SMILES (Isomeric) | COC1=C(C=C2C=CC3=CC(=C(C(=C3C2=C1)OC)O)O)O |
| InChI | InChI=1S/C16H14O5/c1-20-13-7-10-8(5-11(13)17)3-4-9-6-12(18)15(19)16(21-2)14(9)10/h3-7,17-19H,1-2H3 |
| InChI Key | VRVRQHGPVSZZGC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08412354 g/mol |
| Topological Polar Surface Area (TPSA) | 79.20 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.82% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.77% | 94.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.73% | 89.62% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.68% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.66% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.94% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.48% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.39% | 91.49% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.72% | 99.15% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.36% | 92.94% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.78% | 90.20% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.72% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.69% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.65% | 90.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.63% | 96.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.44% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bulbophyllum vaginatum |
| Combretum apiculatum |
| Dendrobium amplum |
| PubChem | 85708339 |
| LOTUS | LTS0032559 |
| wikiData | Q105291993 |