4,6-Dihydroxy-8-methoxy-4-(methoxymethyl)-2-methylbenzo[g][1]benzofuran-5-one
| Internal ID | ee5aa5c1-d29b-4513-a239-8a42605951aa |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | 4,6-dihydroxy-8-methoxy-4-(methoxymethyl)-2-methylbenzo[g][1]benzofuran-5-one |
| SMILES (Canonical) | CC1=CC2=C(O1)C3=C(C(=CC(=C3)OC)O)C(=O)C2(COC)O |
| SMILES (Isomeric) | CC1=CC2=C(O1)C3=C(C(=CC(=C3)OC)O)C(=O)C2(COC)O |
| InChI | InChI=1S/C16H16O6/c1-8-4-11-14(22-8)10-5-9(21-3)6-12(17)13(10)15(18)16(11,19)7-20-2/h4-6,17,19H,7H2,1-3H3 |
| InChI Key | SMEUPAUPJNQLGO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.09468823 g/mol |
| Topological Polar Surface Area (TPSA) | 89.10 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.37% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 95.27% | 90.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.20% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.04% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.04% | 98.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.93% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.81% | 86.33% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.45% | 93.99% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.26% | 96.95% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 85.76% | 90.24% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.98% | 96.09% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.85% | 91.07% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.61% | 99.17% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.92% | 94.80% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.27% | 94.73% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 80.50% | 93.31% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.50% | 97.28% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.02% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162816052 |
| LOTUS | LTS0122139 |
| wikiData | Q104197427 |