4,6-dibromo-3-[4,6-dibromo-2-[(R)-methylsulfinyl]-1H-indol-3-yl]-2-[(S)-methylsulfinyl]-1H-indole
| Internal ID | ab8e89e4-f746-4179-a015-eb5be391165f |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles |
| IUPAC Name | 4,6-dibromo-3-[4,6-dibromo-2-[(R)-methylsulfinyl]-1H-indol-3-yl]-2-[(S)-methylsulfinyl]-1H-indole |
| SMILES (Canonical) | CS(=O)C1=C(C2=C(N1)C=C(C=C2Br)Br)C3=C(NC4=C3C(=CC(=C4)Br)Br)S(=O)C |
| SMILES (Isomeric) | C[S@@](=O)C1=C(C2=C(N1)C=C(C=C2Br)Br)C3=C(NC4=C3C(=CC(=C4)Br)Br)[S@@](=O)C |
| InChI | InChI=1S/C18H12Br4N2O2S2/c1-27(25)17-15(13-9(21)3-7(19)5-11(13)23-17)16-14-10(22)4-8(20)6-12(14)24-18(16)28(2)26/h3-6,23-24H,1-2H3/t27-,28+ |
| InChI Key | XBHNQXJFFIJLEG-HNRBIFIRSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H12Br4N2O2S2 |
| Molecular Weight | 672.10 g/mol |
| Exact Mass | 671.70327 g/mol |
| Topological Polar Surface Area (TPSA) | 104.00 Ų |
| XlogP | 5.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.06% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.61% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.41% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.31% | 98.95% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 89.06% | 93.24% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.37% | 91.11% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 84.03% | 80.96% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 83.07% | 80.33% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 81.46% | 97.23% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.30% | 93.03% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.87% | 90.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.53% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.16% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163195535 |
| LOTUS | LTS0182416 |
| wikiData | Q105324478 |