(2S)-2-[(2R,3S,6R)-2-[2-(furan-3-yl)ethyl]-1,7-dioxaspiro[2.5]octan-6-yl]-6-methylhept-5-ene-1,2-diol
| Internal ID | 81a10cf1-2a41-4b85-9b10-d6743cdbda5b |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols |
| IUPAC Name | (2S)-2-[(2R,3S,6R)-2-[2-(furan-3-yl)ethyl]-1,7-dioxaspiro[2.5]octan-6-yl]-6-methylhept-5-ene-1,2-diol |
| SMILES (Canonical) | CC(=CCCC(CO)(C1CCC2(CO1)C(O2)CCC3=COC=C3)O)C |
| SMILES (Isomeric) | CC(=CCC[C@](CO)([C@H]1CC[C@]2(CO1)[C@H](O2)CCC3=COC=C3)O)C |
| InChI | InChI=1S/C20H30O5/c1-15(2)4-3-9-19(22,13-21)17-7-10-20(14-24-17)18(25-20)6-5-16-8-11-23-12-16/h4,8,11-12,17-18,21-22H,3,5-7,9-10,13-14H2,1-2H3/t17-,18-,19+,20+/m1/s1 |
| InChI Key | UPCWMJMYJYZEHI-ZRNYENFQSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.20932405 g/mol |
| Topological Polar Surface Area (TPSA) | 75.40 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL226 | P30542 | Adenosine A1 receptor | 99.16% | 95.93% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.09% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.80% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.68% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.33% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.72% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.78% | 97.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.51% | 90.17% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.99% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.74% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.68% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.92% | 89.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 83.46% | 98.59% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.12% | 100.00% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.43% | 97.28% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.02% | 93.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.81% | 92.62% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.20% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Baccharis thymifolia |
| PubChem | 44448224 |
| LOTUS | LTS0007363 |
| wikiData | Q105276718 |