[(1R,2R,3aS,4R,5S,5aS,8aR,9S,9aR)-2,4-dihydroxy-5,8a-dimethyl-1'-(4-methylpent-3-enyl)-8-oxospiro[3a,4,5,5a,9,9a-hexahydro-2H-azuleno[6,5-b]furan-1,4'-cyclohexene]-9-yl] 3-methylbut-2-enoate
Internal ID | 1e72c8ae-92e0-4974-8f17-5cd207abbca4 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids |
IUPAC Name | [(1R,2R,3aS,4R,5S,5aS,8aR,9S,9aR)-2,4-dihydroxy-5,8a-dimethyl-1'-(4-methylpent-3-enyl)-8-oxospiro[3a,4,5,5a,9,9a-hexahydro-2H-azuleno[6,5-b]furan-1,4'-cyclohexene]-9-yl] 3-methylbut-2-enoate |
SMILES (Canonical) | CC1C2C=CC(=O)C2(C(C3C(C1O)OC(C34CCC(=CC4)CCC=C(C)C)O)OC(=O)C=C(C)C)C |
SMILES (Isomeric) | C[C@H]1[C@@H]2C=CC(=O)[C@]2([C@H]([C@@H]3[C@@H]([C@@H]1O)O[C@H]([C@@]34CCC(=CC4)CCC=C(C)C)O)OC(=O)C=C(C)C)C |
InChI | InChI=1S/C30H42O6/c1-17(2)8-7-9-20-12-14-30(15-13-20)24-26(36-28(30)34)25(33)19(5)21-10-11-22(31)29(21,6)27(24)35-23(32)16-18(3)4/h8,10-12,16,19,21,24-28,33-34H,7,9,13-15H2,1-6H3/t19-,21-,24-,25+,26-,27-,28+,29-,30-/m0/s1 |
InChI Key | LPBDMWXGWLCZFZ-VJYWZQHKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H42O6 |
Molecular Weight | 498.60 g/mol |
Exact Mass | 498.29813906 g/mol |
Topological Polar Surface Area (TPSA) | 93.10 Ų |
XlogP | 4.90 |
There are no found synonyms. |
![2D Structure of [(1R,2R,3aS,4R,5S,5aS,8aR,9S,9aR)-2,4-dihydroxy-5,8a-dimethyl-1'-(4-methylpent-3-enyl)-8-oxospiro[3a,4,5,5a,9,9a-hexahydro-2H-azuleno[6,5-b]furan-1,4'-cyclohexene]-9-yl] 3-methylbut-2-enoate 2D Structure of [(1R,2R,3aS,4R,5S,5aS,8aR,9S,9aR)-2,4-dihydroxy-5,8a-dimethyl-1'-(4-methylpent-3-enyl)-8-oxospiro[3a,4,5,5a,9,9a-hexahydro-2H-azuleno[6,5-b]furan-1,4'-cyclohexene]-9-yl] 3-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/452cf470-8638-11ee-aa72-a784fdb96d0d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.21% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.45% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 94.84% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.70% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.22% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.13% | 86.33% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 89.44% | 91.07% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.99% | 94.73% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.38% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.18% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.19% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.81% | 89.00% |
CHEMBL5028 | O14672 | ADAM10 | 82.13% | 97.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.20% | 94.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.82% | 94.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.43% | 97.09% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.41% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.22% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tetraneuris ivesiana |
PubChem | 162847625 |
LOTUS | LTS0253332 |
wikiData | Q105155018 |