4,5,15-Trimethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13(17),14-octaen-16-one
| Internal ID | 69841585-bde7-4d22-9ca3-e827ae87d627 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 4,5,15-trimethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13(17),14-octaen-16-one |
| SMILES (Canonical) | COC1=CC2=C3C(=NC=C2)C=C4C=C(C(=CC4=C3C1=O)OC)OC |
| SMILES (Isomeric) | COC1=CC2=C3C(=NC=C2)C=C4C=C(C(=CC4=C3C1=O)OC)OC |
| InChI | InChI=1S/C19H15NO4/c1-22-14-8-11-6-13-17-10(4-5-20-13)7-16(24-3)19(21)18(17)12(11)9-15(14)23-2/h4-9H,1-3H3 |
| InChI Key | XHCICOLGLYLOAA-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.10010796 g/mol |
| Topological Polar Surface Area (TPSA) | 57.60 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
![2D Structure of 4,5,15-Trimethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13(17),14-octaen-16-one](https://plantaedb.com/storage/docs/compounds/2023/11/4515-trimethoxy-10-azatetracyclo77102701317heptadeca-1357911131714-octaen-16-one.jpg "2D Structure of 4,5,15-Trimethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9,11,13(17),14-octaen-16-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.99% | 85.14% |
| CHEMBL2535 | P11166 | Glucose transporter | 95.07% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.19% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.56% | 91.11% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 91.96% | 92.38% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.91% | 91.49% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.41% | 96.00% |
| CHEMBL5014 | O43353 | Serine/threonine-protein kinase RIPK2 | 88.87% | 86.79% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 88.78% | 96.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.73% | 86.33% |
| CHEMBL235 | P37231 | Peroxisome proliferator-activated receptor gamma | 88.03% | 95.39% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 87.88% | 92.97% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 87.03% | 96.47% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.23% | 95.56% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 84.18% | 94.03% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.89% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.67% | 89.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.39% | 96.90% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.65% | 92.94% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 82.41% | 94.42% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.25% | 96.09% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.06% | 100.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 82.02% | 90.20% |
| CHEMBL290 | Q13370 | Phosphodiesterase 3B | 81.75% | 94.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.16% | 90.71% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 81.04% | 96.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.96% | 99.23% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 80.93% | 95.12% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.09% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Corydalis paniculigera |
| Corydalis stricta |
| PubChem | 21609480 |
| LOTUS | LTS0139987 |
| wikiData | Q105328014 |