N-[(5R)-4-amino-3-[3-amino-6-(1-aminoethyl)oxan-2-yl]oxy-2,5-dihydroxy-6-methoxycyclohexyl]-2-(aminomethylideneamino)-N-methylacetamide
| Internal ID | 7140a5b2-da66-4e03-a56f-717eb2728fda |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Aminosaccharides > Aminoglycosides > Aminocyclitol glycosides |
| IUPAC Name | N-[(5R)-4-amino-3-[3-amino-6-(1-aminoethyl)oxan-2-yl]oxy-2,5-dihydroxy-6-methoxycyclohexyl]-2-(aminomethylideneamino)-N-methylacetamide |
| SMILES (Canonical) | CC(C1CCC(C(O1)OC2C(C(C(C(C2O)N(C)C(=O)CN=CN)OC)O)N)N)N |
| SMILES (Isomeric) | CC(C1CCC(C(O1)OC2C([C@H](C(C(C2O)N(C)C(=O)CN=CN)OC)O)N)N)N |
| InChI | InChI=1S/C18H36N6O6/c1-8(20)10-5-4-9(21)18(29-10)30-16-12(22)14(26)17(28-3)13(15(16)27)24(2)11(25)6-23-7-19/h7-10,12-18,26-27H,4-6,20-22H2,1-3H3,(H2,19,23)/t8?,9?,10?,12?,13?,14-,15?,16?,17?,18?/m1/s1 |
| InChI Key | VFBPKQSATYZKRX-RGARXHHKSA-N |
| Popularity | 30 references in papers |
| Molecular Formula | C18H36N6O6 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.26963289 g/mol |
| Topological Polar Surface Area (TPSA) | 205.00 Ų |
| XlogP | -4.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.28% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.21% | 97.09% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 92.74% | 95.89% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 92.70% | 97.47% |
| CHEMBL204 | P00734 | Thrombin | 92.34% | 96.01% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.31% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.63% | 91.11% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.39% | 96.77% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.09% | 96.95% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.49% | 98.95% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 88.09% | 98.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.00% | 95.89% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.66% | 96.47% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.86% | 94.33% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.60% | 91.19% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 84.11% | 95.93% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.94% | 90.71% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 83.42% | 95.58% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.53% | 95.56% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 81.89% | 85.31% |
| CHEMBL1871 | P10275 | Androgen Receptor | 81.26% | 96.43% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.68% | 95.71% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.43% | 96.38% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 80.42% | 96.25% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.16% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139589116 |
| LOTUS | LTS0075372 |
| wikiData | Q105285061 |