4,5-dihydroxy-N-(2-methylpropyl)oct-2-enamide
| Internal ID | a4721629-d606-4c07-bcd5-07bc7896d2bc |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | 4,5-dihydroxy-N-(2-methylpropyl)oct-2-enamide |
| SMILES (Canonical) | CCCC(C(C=CC(=O)NCC(C)C)O)O |
| SMILES (Isomeric) | CCCC(C(C=CC(=O)NCC(C)C)O)O |
| InChI | InChI=1S/C12H23NO3/c1-4-5-10(14)11(15)6-7-12(16)13-8-9(2)3/h6-7,9-11,14-15H,4-5,8H2,1-3H3,(H,13,16) |
| InChI Key | DVFBBRGYRFXMCJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.16779360 g/mol |
| Topological Polar Surface Area (TPSA) | 69.60 Ų |
| XlogP | 1.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.21% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.01% | 96.09% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 94.98% | 97.29% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 94.84% | 89.34% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 90.39% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.72% | 93.56% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.20% | 100.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.62% | 83.82% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.42% | 90.17% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 85.66% | 95.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.28% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.13% | 99.17% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 84.03% | 82.50% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.84% | 98.75% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.38% | 98.05% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.04% | 97.25% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.28% | 90.71% |
| CHEMBL1907588 | P02708 | Acetylcholine receptor; alpha1/beta1/delta/gamma | 81.13% | 98.33% |
| CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 81.04% | 98.57% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 80.77% | 98.59% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piper nigrum |
| PubChem | 72965309 |
| LOTUS | LTS0264931 |
| wikiData | Q104989953 |