4',5-Dihydroxy-7-methylflavone
| Internal ID | 640a3f0b-cfbd-494b-93e5-a94ef4883c0f |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones |
| IUPAC Name | 5-hydroxy-2-(4-hydroxyphenyl)-7-methylchromen-4-one |
| SMILES (Canonical) | CC1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=C(C=C3)O)O |
| SMILES (Isomeric) | CC1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=C(C=C3)O)O |
| InChI | InChI=1S/C16H12O4/c1-9-6-12(18)16-13(19)8-14(20-15(16)7-9)10-2-4-11(17)5-3-10/h2-8,17-18H,1H3 |
| InChI Key | SDTOABMYDICPQU-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.07355886 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 2.50 |
| 4',5-dihydroxy-7-methylflavone |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.76% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.13% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.38% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.85% | 85.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.54% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.42% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.69% | 91.49% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.60% | 94.73% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 91.50% | 98.35% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.08% | 99.15% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 88.56% | 93.65% |
| CHEMBL3194 | P02766 | Transthyretin | 88.20% | 90.71% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.65% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.59% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.02% | 99.23% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 82.90% | 91.76% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 82.26% | 90.93% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 80.95% | 89.23% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 80.54% | 91.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arnica viscosa |
| Dracocephalum multicaule |
| PubChem | 60082424 |
| LOTUS | LTS0111437 |
| wikiData | Q105250829 |