4,5-Dihydroxy-1-piperidin-1-yldec-2-en-1-one
| Internal ID | a6e11997-bad8-4b1c-bce0-541ee2599cf1 |
| Taxonomy | Organoheterocyclic compounds > Piperidines > N-acylpiperidines |
| IUPAC Name | 4,5-dihydroxy-1-piperidin-1-yldec-2-en-1-one |
| SMILES (Canonical) | CCCCCC(C(C=CC(=O)N1CCCCC1)O)O |
| SMILES (Isomeric) | CCCCCC(C(C=CC(=O)N1CCCCC1)O)O |
| InChI | InChI=1S/C15H27NO3/c1-2-3-5-8-13(17)14(18)9-10-15(19)16-11-6-4-7-12-16/h9-10,13-14,17-18H,2-8,11-12H2,1H3 |
| InChI Key | BFKPVZSEVYPLTK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.19909372 g/mol |
| Topological Polar Surface Area (TPSA) | 60.80 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.40% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.97% | 96.09% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 94.00% | 91.81% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 93.58% | 92.86% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 91.63% | 89.63% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 90.28% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.23% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.80% | 93.56% |
| CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 | 89.80% | 93.90% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.63% | 97.25% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.35% | 90.71% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 85.51% | 98.33% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 85.36% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.13% | 99.17% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.07% | 97.29% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.55% | 94.33% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.80% | 95.50% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 81.14% | 96.25% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.99% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piper nigrum |
| PubChem | 85416577 |
| LOTUS | LTS0031490 |
| wikiData | Q104934336 |