4,5-dibromo-N-[(3Z)-3-(2,5-dioxoimidazolidin-4-ylidene)propyl]-1H-pyrrole-2-carboxamide
| Internal ID | 2e63dc38-517d-4f8a-8b73-a63d054ae59d |
| Taxonomy | Organoheterocyclic compounds > Azolidines > Imidazolidines > Hydantoins |
| IUPAC Name | 4,5-dibromo-N-[(3Z)-3-(2,5-dioxoimidazolidin-4-ylidene)propyl]-1H-pyrrole-2-carboxamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H10Br2N4O3/c12-5-4-7(15-8(5)13)9(18)14-3-1-2-6-10(19)17-11(20)16-6/h2,4,15H,1,3H2,(H,14,18)(H2,16,17,19,20)/b6-2- |
| InChI Key | HSXRXYKWRAQPTE-KXFIGUGUSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C11H10Br2N4O3 |
| Molecular Weight | 406.03 g/mol |
| Exact Mass | 405.90992 g/mol |
| Topological Polar Surface Area (TPSA) | 103.00 Ų |
| XlogP | 1.50 |
| There are no found synonyms. |
![2D Structure of 4,5-dibromo-N-[(3Z)-3-(2,5-dioxoimidazolidin-4-ylidene)propyl]-1H-pyrrole-2-carboxamide](https://plantaedb.com/storage/docs/compounds/2023/11/45-dibromo-n-3z-3-25-dioxoimidazolidin-4-ylidenepropyl-1h-pyrrole-2-carboxamide.jpg "2D Structure of 4,5-dibromo-N-[(3Z)-3-(2,5-dioxoimidazolidin-4-ylidene)propyl]-1H-pyrrole-2-carboxamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.45% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.43% | 94.45% |
| CHEMBL1829 | O15379 | Histone deacetylase 3 | 94.42% | 95.00% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 92.20% | 89.34% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.10% | 83.82% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.55% | 94.75% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.90% | 91.07% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.67% | 96.09% |
| CHEMBL279 | P35968 | Vascular endothelial growth factor receptor 2 | 88.13% | 95.52% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 87.45% | 83.57% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.42% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.21% | 90.00% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 86.38% | 89.67% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 85.22% | 80.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 85.12% | 98.59% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.41% | 92.88% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.00% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.74% | 94.73% |
| CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 82.23% | 94.01% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 81.80% | 81.11% |
| CHEMBL4531 | P17931 | Galectin-3 | 80.06% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 640319 |
| LOTUS | LTS0070944 |
| wikiData | Q105033312 |