[(1S,2S,6S,9S,10S,11R,12R,13S,14S,15S,16R,18S,19S,22S,23S,25R)-16-acetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S)-2-hydroxy-2-methylbutanoate
Internal ID | 85a79d98-1434-4405-84f3-0fb92408caa8 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal alkaloids > Cerveratrum-type alkaloids |
IUPAC Name | [(1S,2S,6S,9S,10S,11R,12R,13S,14S,15S,16R,18S,19S,22S,23S,25R)-16-acetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S)-2-hydroxy-2-methylbutanoate |
SMILES (Canonical) | CCC(C)C(=O)OC1C(C2C(CN3CC(CCC3C2(C)O)C)C4C1(C5C(CC6C7(C5(C4)OC6(C(CC7)OC(=O)C(C)(CC)O)O)C)OC(=O)C)O)O |
SMILES (Isomeric) | CC[C@@H](C)C(=O)O[C@H]1[C@@H]([C@H]2[C@@H](CN3C[C@H](CC[C@H]3[C@@]2(C)O)C)[C@H]4[C@@]1([C@@H]5[C@@H](C[C@H]6[C@]7([C@]5(C4)O[C@@]6([C@H](CC7)OC(=O)[C@](C)(CC)O)O)C)OC(=O)C)O)O |
InChI | InChI=1S/C39H61NO12/c1-9-20(4)32(43)51-31-29(42)28-22(18-40-17-19(3)11-12-26(40)36(28,8)46)23-16-37-30(38(23,31)47)24(49-21(5)41)15-25-34(37,6)14-13-27(39(25,48)52-37)50-33(44)35(7,45)10-2/h19-20,22-31,42,45-48H,9-18H2,1-8H3/t19-,20+,22-,23-,24+,25-,26-,27-,28+,29+,30+,31-,34-,35-,36+,37+,38-,39-/m0/s1 |
InChI Key | FLFCQWMYNRYARR-PUUWZZPASA-N |
Popularity | 1 reference in papers |
Molecular Formula | C39H61NO12 |
Molecular Weight | 735.90 g/mol |
Exact Mass | 735.41937638 g/mol |
Topological Polar Surface Area (TPSA) | 193.00 Ų |
XlogP | 2.50 |
Atomic LogP (AlogP) | 2.07 |
H-Bond Acceptor | 13 |
H-Bond Donor | 5 |
Rotatable Bonds | 7 |
There are no found synonyms. |
![2D Structure of [(1S,2S,6S,9S,10S,11R,12R,13S,14S,15S,16R,18S,19S,22S,23S,25R)-16-acetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S)-2-hydroxy-2-methylbutanoate 2D Structure of [(1S,2S,6S,9S,10S,11R,12R,13S,14S,15S,16R,18S,19S,22S,23S,25R)-16-acetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S)-2-hydroxy-2-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/44b34b20-83a6-11ee-b76e-a5cc560397d1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.6715 | 67.15% |
Caco-2 | - | 0.8587 | 85.87% |
Blood Brain Barrier | + | 0.7250 | 72.50% |
Human oral bioavailability | - | 0.6714 | 67.14% |
Subcellular localzation | Lysosomes | 0.6149 | 61.49% |
OATP2B1 inhibitior | - | 0.7333 | 73.33% |
OATP1B1 inhibitior | + | 0.9134 | 91.34% |
OATP1B3 inhibitior | + | 0.9480 | 94.80% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | - | 0.8000 | 80.00% |
BSEP inhibitior | + | 0.7268 | 72.68% |
P-glycoprotein inhibitior | + | 0.7588 | 75.88% |
P-glycoprotein substrate | + | 0.7151 | 71.51% |
CYP3A4 substrate | + | 0.7493 | 74.93% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.7867 | 78.67% |
CYP3A4 inhibition | - | 0.8309 | 83.09% |
CYP2C9 inhibition | - | 0.9078 | 90.78% |
CYP2C19 inhibition | - | 0.9025 | 90.25% |
CYP2D6 inhibition | - | 0.9308 | 93.08% |
CYP1A2 inhibition | - | 0.9425 | 94.25% |
CYP2C8 inhibition | + | 0.7504 | 75.04% |
CYP inhibitory promiscuity | - | 0.9613 | 96.13% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 1.0000 | 100.00% |
Carcinogenicity (trinary) | Non-required | 0.5302 | 53.02% |
Eye corrosion | - | 0.9891 | 98.91% |
Eye irritation | - | 0.9138 | 91.38% |
Skin irritation | - | 0.7598 | 75.98% |
Skin corrosion | - | 0.9349 | 93.49% |
Ames mutagenesis | - | 0.5911 | 59.11% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5000 | 50.00% |
Micronuclear | + | 0.5500 | 55.00% |
Hepatotoxicity | + | 0.5072 | 50.72% |
skin sensitisation | - | 0.8817 | 88.17% |
Respiratory toxicity | + | 0.6667 | 66.67% |
Reproductive toxicity | + | 0.9000 | 90.00% |
Mitochondrial toxicity | + | 0.9750 | 97.50% |
Nephrotoxicity | + | 0.5100 | 51.00% |
Acute Oral Toxicity (c) | I | 0.8149 | 81.49% |
Estrogen receptor binding | + | 0.7055 | 70.55% |
Androgen receptor binding | + | 0.7582 | 75.82% |
Thyroid receptor binding | - | 0.5716 | 57.16% |
Glucocorticoid receptor binding | + | 0.7235 | 72.35% |
Aromatase binding | + | 0.6607 | 66.07% |
PPAR gamma | + | 0.7305 | 73.05% |
Honey bee toxicity | - | 0.6568 | 65.68% |
Biodegradation | - | 0.7500 | 75.00% |
Crustacea aquatic toxicity | + | 0.5400 | 54.00% |
Fish aquatic toxicity | + | 0.7302 | 73.02% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.94% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.20% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.70% | 96.77% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.77% | 85.14% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 96.17% | 89.05% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 95.44% | 95.00% |
CHEMBL2581 | P07339 | Cathepsin D | 94.58% | 98.95% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 93.73% | 97.79% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.25% | 94.45% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.67% | 97.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.95% | 86.33% |
CHEMBL299 | P17252 | Protein kinase C alpha | 91.80% | 98.03% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 91.19% | 97.28% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.16% | 82.69% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.10% | 95.89% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 90.55% | 100.00% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 90.14% | 95.36% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.76% | 97.09% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 89.54% | 91.03% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 89.14% | 82.50% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.87% | 89.50% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 88.49% | 99.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.32% | 100.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.13% | 96.47% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.74% | 93.56% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.71% | 100.00% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 85.81% | 99.00% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.66% | 95.38% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.48% | 95.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.97% | 95.89% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.73% | 92.50% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.51% | 96.90% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 84.13% | 94.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.98% | 100.00% |
CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 83.95% | 88.81% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.91% | 98.05% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.23% | 95.71% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.75% | 98.75% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.51% | 97.50% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 82.09% | 97.29% |
CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 81.80% | 95.27% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.50% | 95.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.36% | 94.00% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 81.30% | 90.93% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 81.22% | 92.68% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.06% | 89.00% |
CHEMBL3837 | P07711 | Cathepsin L | 81.01% | 96.61% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.75% | 94.08% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.72% | 91.11% |
CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 80.32% | 97.56% |
CHEMBL3045 | P05771 | Protein kinase C beta | 80.32% | 97.63% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Veratrum viride |
PubChem | 163003057 |
LOTUS | LTS0265034 |
wikiData | Q104997021 |