4,4',alpha-Trihydroxy-2'-methoxydihydrochalcone
Internal ID | 57d4066b-f6f9-41e6-b002-460f27878c95 |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Cinnamylphenols |
IUPAC Name | 2-hydroxy-1-(4-hydroxy-2-methoxyphenyl)-3-(4-hydroxyphenyl)propan-1-one |
SMILES (Canonical) | COC1=C(C=CC(=C1)O)C(=O)C(CC2=CC=C(C=C2)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)O)C(=O)C(CC2=CC=C(C=C2)O)O |
InChI | InChI=1S/C16H16O5/c1-21-15-9-12(18)6-7-13(15)16(20)14(19)8-10-2-4-11(17)5-3-10/h2-7,9,14,17-19H,8H2,1H3 |
InChI Key | FDKXRBOKHKHJHH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H16O5 |
Molecular Weight | 288.29 g/mol |
Exact Mass | 288.09977361 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 2.20 |
LMPK12120577 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.81% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 97.65% | 98.95% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 94.56% | 90.20% |
CHEMBL2535 | P11166 | Glucose transporter | 94.40% | 98.75% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.58% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.21% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.69% | 94.45% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.17% | 95.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.25% | 95.89% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.67% | 96.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.15% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.55% | 85.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.35% | 90.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.24% | 97.21% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.44% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.60% | 94.00% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.90% | 100.00% |
CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 80.76% | 92.29% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.28% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Xanthocercis zambesiaca |
PubChem | 14160611 |
LOTUS | LTS0052910 |
wikiData | Q104993633 |