1-(2-Hydroxy-4,7-dimethoxyphenanthren-1-yl)-4,7-dimethoxyphenanthren-2-ol
| Internal ID | b20aec9c-6a6c-4212-8abf-7f71c8e237a9 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthrols |
| IUPAC Name | 1-(2-hydroxy-4,7-dimethoxyphenanthren-1-yl)-4,7-dimethoxyphenanthren-2-ol |
| SMILES (Canonical) | COC1=CC2=C(C=C1)C3=C(C=C(C(=C3C=C2)C4=C5C=CC6=C(C5=C(C=C4O)OC)C=CC(=C6)OC)O)OC |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)C3=C(C=C(C(=C3C=C2)C4=C5C=CC6=C(C5=C(C=C4O)OC)C=CC(=C6)OC)O)OC |
| InChI | InChI=1S/C32H26O6/c1-35-19-7-11-21-17(13-19)5-9-23-29(21)27(37-3)15-25(33)31(23)32-24-10-6-18-14-20(36-2)8-12-22(18)30(24)28(38-4)16-26(32)34/h5-16,33-34H,1-4H3 |
| InChI Key | OYYLGWXTPCWTAJ-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C32H26O6 |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 506.17293854 g/mol |
| Topological Polar Surface Area (TPSA) | 77.40 Ų |
| XlogP | 7.70 |
| 4,4',7,7'-Tetramethoxy-1,1'-biphenanthrene-2,2'-diol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.87% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.88% | 90.00% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 92.41% | 91.79% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.37% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.85% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.16% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.14% | 93.99% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.57% | 94.45% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.46% | 92.94% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.35% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.95% | 98.75% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.86% | 96.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.09% | 93.31% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.05% | 89.62% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.40% | 96.09% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.35% | 92.62% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.18% | 86.92% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 82.09% | 92.68% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 81.68% | 90.20% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.50% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.75% | 98.95% |
| CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 80.27% | 94.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cremastra appendiculata |
| Eriodes barbata |
| PubChem | 11684843 |
| NPASS | NPC71465 |
| ChEMBL | CHEMBL498129 |
| LOTUS | LTS0140235 |
| wikiData | Q105203613 |