4,4',6-Tribromo-2,2'-Biphenol
| Internal ID | f0eadf7f-a713-455d-baa2-a7ae67ad3215 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Biphenyls and derivatives > Brominated biphenyls > Polybrominated biphenyls |
| IUPAC Name | 2,4-dibromo-6-(5-bromo-2-hydroxyphenyl)phenol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C12H7Br3O2/c13-6-1-2-11(16)8(3-6)9-4-7(14)5-10(15)12(9)17/h1-5,16-17H |
| InChI Key | KLKDPRUXCGOLFU-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C12H7Br3O2 |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 421.79757 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 4.90 |
| RefChem:911803 |
| 2,4-dibromo-6-(5-bromo-2-hydroxyphenyl)phenol |
| 3,5,5'-tribromo-[1,1'-biphenyl]-2,2'-diol |
| CHEMBL1641935 |
| CHEBI:70618 |
| 4',4,6-tribromo-2,2-biphenol |
| Q27138951 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.57% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.89% | 99.15% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 88.60% | 98.35% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 88.51% | 98.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.94% | 95.56% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 86.67% | 83.57% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 86.02% | 91.79% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 85.56% | 93.24% |
| CHEMBL3194 | P02766 | Transthyretin | 85.54% | 90.71% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.28% | 89.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.77% | 90.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.11% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 50899959 |
| LOTUS | LTS0126238 |
| wikiData | Q27138951 |