4,4-dichloro-N,3-dimethyl-N-(4,4,4-trichloro-3-methyl-1-thiazol-2-yl-butyl)butanamide
| Internal ID | 3d4d5493-4e8f-480f-b8f9-84eebf4c745b |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | 4,4-dichloro-N,3-dimethyl-N-[4,4,4-trichloro-3-methyl-1-(1,3-thiazol-2-yl)butyl]butanamide |
| SMILES (Canonical) | CC(CC(C1=NC=CS1)N(C)C(=O)CC(C)C(Cl)Cl)C(Cl)(Cl)Cl |
| SMILES (Isomeric) | CC(CC(C1=NC=CS1)N(C)C(=O)CC(C)C(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H19Cl5N2OS/c1-8(12(15)16)6-11(22)21(3)10(13-20-4-5-23-13)7-9(2)14(17,18)19/h4-5,8-10,12H,6-7H2,1-3H3 |
| InChI Key | PVPMFKJSAWTERQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H19Cl5N2OS |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 439.963123 g/mol |
| Topological Polar Surface Area (TPSA) | 61.40 Ų |
| XlogP | 5.40 |
| 10-Dechloro-N-methyldysideathiazole |
| 4,4-dichloro-N,3-dimethyl-N-(4,4,4-trichloro-3-methyl-1-thiazol-2-yl-butyl)butanamide |
| 4,4-Dichloro-N,3-dimethyl-N-(4,4,4-trichloro-3-methyl-1-(1,3-thiazol-2-yl)butyl)butanamide |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 97.33% | 89.34% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.47% | 96.09% |
| CHEMBL240 | Q12809 | HERG | 93.23% | 89.76% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.79% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.33% | 98.95% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 88.35% | 96.90% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 88.08% | 93.10% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 87.77% | 100.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.38% | 90.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 84.43% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.59% | 99.17% |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 81.84% | 95.71% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.36% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 494506 |
| LOTUS | LTS0123424 |
| wikiData | Q105215559 |