[4,10,13-trimethyl-17-(5-propan-2-ylhept-5-en-2-yl)-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate
Internal ID | a451118e-78b7-4373-be2b-a656448257c5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [4,10,13-trimethyl-17-(5-propan-2-ylhept-5-en-2-yl)-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
SMILES (Canonical) | CC=C(CCC(C)C1CCC2C1(CCC3=C2CCC4C3(CCC(C4C)OC(=O)C)C)C)C(C)C |
SMILES (Isomeric) | CC=C(CCC(C)C1CCC2C1(CCC3=C2CCC4C3(CCC(C4C)OC(=O)C)C)C)C(C)C |
InChI | InChI=1S/C32H52O2/c1-9-24(20(2)3)11-10-21(4)26-14-15-28-25-12-13-27-22(5)30(34-23(6)33)17-19-32(27,8)29(25)16-18-31(26,28)7/h9,20-22,26-28,30H,10-19H2,1-8H3 |
InChI Key | PMXQGXSNFUWYMT-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H52O2 |
Molecular Weight | 468.80 g/mol |
Exact Mass | 468.396730897 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 9.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.33% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.68% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.81% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.18% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 94.46% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.90% | 95.89% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.03% | 90.17% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 88.43% | 91.24% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 88.39% | 89.05% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.84% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.72% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.26% | 100.00% |
CHEMBL233 | P35372 | Mu opioid receptor | 86.36% | 97.93% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.45% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.44% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.43% | 95.89% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 83.92% | 95.58% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.36% | 96.38% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.92% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.86% | 94.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.58% | 95.56% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.42% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phaseolus vulgaris |
PubChem | 85977280 |
LOTUS | LTS0129378 |
wikiData | Q105211805 |