[6-[3-[3-(4-aminobutylamino)propylamino]-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-hydroxy-2-methylheptyl] hydrogen sulfate
| Internal ID | f40dd230-2330-4f49-bc4d-1bc2b3bf24c8 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Bile acids, alcohols and derivatives > Hydroxy bile acids, alcohols and derivatives > Dihydroxy bile acids, alcohols and derivatives |
| IUPAC Name | [6-[3-[3-(4-aminobutylamino)propylamino]-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-hydroxy-2-methylheptyl] hydrogen sulfate |
| SMILES (Canonical) | CC(CCC(C(C)COS(=O)(=O)O)O)C1CCC2C1(CCC3C2C(CC4C3(CCC(C4)NCCCNCCCCN)C)O)C |
| SMILES (Isomeric) | CC(CCC(C(C)COS(=O)(=O)O)O)C1CCC2C1(CCC3C2C(CC4C3(CCC(C4)NCCCNCCCCN)C)O)C |
| InChI | InChI=1S/C34H65N3O6S/c1-23(8-11-30(38)24(2)22-43-44(40,41)42)27-9-10-28-32-29(13-15-34(27,28)4)33(3)14-12-26(20-25(33)21-31(32)39)37-19-7-18-36-17-6-5-16-35/h23-32,36-39H,5-22,35H2,1-4H3,(H,40,41,42) |
| InChI Key | BBVHNXGALDVEEE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C34H65N3O6S |
| Molecular Weight | 644.00 g/mol |
| Exact Mass | 643.45940798 g/mol |
| Topological Polar Surface Area (TPSA) | 163.00 Ų |
| XlogP | 3.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.31% | 96.09% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 98.83% | 95.58% |
| CHEMBL3837 | P07711 | Cathepsin L | 98.66% | 96.61% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 97.77% | 85.31% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 96.03% | 95.93% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 95.89% | 97.29% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 95.80% | 98.05% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 94.37% | 95.89% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.17% | 90.17% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 93.98% | 91.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.45% | 97.09% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 93.17% | 95.71% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 92.97% | 100.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.42% | 82.69% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.10% | 98.95% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 91.94% | 95.69% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.94% | 94.45% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 91.81% | 93.18% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.72% | 91.11% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.56% | 95.50% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 90.55% | 96.38% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 90.55% | 90.24% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 90.51% | 99.17% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 90.00% | 97.23% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.86% | 97.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.64% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.12% | 90.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.94% | 96.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 88.90% | 94.33% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 88.72% | 92.86% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.65% | 95.56% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 87.95% | 91.03% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 87.09% | 96.03% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 86.55% | 96.67% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 86.30% | 98.75% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 86.18% | 100.00% |
| CHEMBL1871 | P10275 | Androgen Receptor | 85.99% | 96.43% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.52% | 96.47% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.06% | 96.90% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.68% | 95.89% |
| CHEMBL3055 | P50613 | Cyclin-dependent kinase 7 | 83.30% | 81.88% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.08% | 95.83% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.02% | 93.56% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.43% | 91.19% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.08% | 92.88% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.84% | 93.03% |
| CHEMBL5646 | Q6L5J4 | FML2_HUMAN | 81.32% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.48% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73837040 |
| LOTUS | LTS0085886 |
| wikiData | Q104923086 |