9-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxy-3H-benzo[f][2]benzofuran-1-one
Internal ID | 3145ecb4-1da4-4403-baac-8771be4152e3 |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | 9-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxy-3H-benzo[f][2]benzofuran-1-one |
SMILES (Canonical) | COC1=C(C=C2C(=C1)C(=C3C(=C2OC4C(C(C(C(O4)COC5C(C(C(CO5)O)O)O)O)O)O)COC3=O)C6=CC7=C(C=C6)OCO7)OC |
SMILES (Isomeric) | COC1=C(C=C2C(=C1)C(=C3C(=C2O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO[C@H]5[C@@H]([C@H]([C@H](CO5)O)O)O)O)O)O)COC3=O)C6=CC7=C(C=C6)OCO7)OC |
InChI | InChI=1S/C32H34O16/c1-40-18-6-13-14(7-19(18)41-2)29(15-8-42-30(39)23(15)22(13)12-3-4-17-20(5-12)46-11-45-17)48-32-28(38)26(36)25(35)21(47-32)10-44-31-27(37)24(34)16(33)9-43-31/h3-7,16,21,24-28,31-38H,8-11H2,1-2H3/t16-,21+,24-,25+,26-,27+,28+,31-,32-/m0/s1 |
InChI Key | FQMUJJZFGOZSSZ-CCCWDYDVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H34O16 |
Molecular Weight | 674.60 g/mol |
Exact Mass | 674.18468499 g/mol |
Topological Polar Surface Area (TPSA) | 222.00 Ų |
XlogP | -0.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.39% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.12% | 85.14% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.49% | 96.77% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.40% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 97.17% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.83% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.89% | 86.33% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 95.54% | 94.80% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 95.36% | 92.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.86% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.14% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.65% | 91.49% |
CHEMBL2535 | P11166 | Glucose transporter | 91.66% | 98.75% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.49% | 94.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.08% | 89.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.04% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.94% | 96.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.90% | 100.00% |
CHEMBL1907 | P15144 | Aminopeptidase N | 83.99% | 93.31% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 83.15% | 95.53% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.09% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.46% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.31% | 94.73% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 81.23% | 80.96% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Haplophyllum patavinum |
PubChem | 14731306 |
LOTUS | LTS0034618 |
wikiData | Q104999723 |