[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [2-(3,14-dihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-6-hydroxy-6-methylheptan-3-yl] hydrogen phosphate
| Internal ID | d26b2581-8154-46fb-bb81-8916268e1048 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
| IUPAC Name | [5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [2-(3,14-dihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-6-hydroxy-6-methylheptan-3-yl] hydrogen phosphate |
| SMILES (Canonical) | CC(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CCC(C4)O)C)C)O)C(CCC(C)(C)O)OP(=O)(O)OCC5C(C(C(O5)N6C=NC7=C(N=CN=C76)N)O)O |
| SMILES (Isomeric) | CC(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CCC(C4)O)C)C)O)C(CCC(C)(C)O)OP(=O)(O)OCC5C(C(C(O5)N6C=NC7=C(N=CN=C76)N)O)O |
| InChI | InChI=1S/C37H56N5O11P/c1-19(21-8-13-37(48)23-15-25(44)24-14-20(43)6-11-35(24,4)22(23)7-12-36(21,37)5)26(9-10-34(2,3)47)53-54(49,50)51-16-27-29(45)30(46)33(52-27)42-18-41-28-31(38)39-17-40-32(28)42/h15,17-22,24,26-27,29-30,33,43,45-48H,6-14,16H2,1-5H3,(H,49,50)(H2,38,39,40) |
| InChI Key | UQJHEPIKTHIJFC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C37H56N5O11P |
| Molecular Weight | 777.80 g/mol |
| Exact Mass | 777.37139462 g/mol |
| Topological Polar Surface Area (TPSA) | 253.00 Ų |
| XlogP | 0.10 |
| Atomic LogP (AlogP) | 2.95 |
| H-Bond Acceptor | 15 |
| H-Bond Donor | 7 |
| Rotatable Bonds | 11 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9540 | 95.40% |
| Caco-2 | - | 0.8630 | 86.30% |
| Blood Brain Barrier | - | 0.7500 | 75.00% |
| Human oral bioavailability | - | 0.6000 | 60.00% |
| Subcellular localzation | Mitochondria | 0.4513 | 45.13% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8438 | 84.38% |
| OATP1B3 inhibitior | + | 0.9331 | 93.31% |
| MATE1 inhibitior | - | 0.9000 | 90.00% |
| OCT2 inhibitior | - | 0.8561 | 85.61% |
| BSEP inhibitior | + | 0.7684 | 76.84% |
| P-glycoprotein inhibitior | + | 0.7471 | 74.71% |
| P-glycoprotein substrate | + | 0.7569 | 75.69% |
| CYP3A4 substrate | + | 0.7313 | 73.13% |
| CYP2C9 substrate | - | 0.8016 | 80.16% |
| CYP2D6 substrate | - | 0.8729 | 87.29% |
| CYP3A4 inhibition | - | 0.7078 | 70.78% |
| CYP2C9 inhibition | - | 0.8068 | 80.68% |
| CYP2C19 inhibition | - | 0.7756 | 77.56% |
| CYP2D6 inhibition | - | 0.8648 | 86.48% |
| CYP1A2 inhibition | - | 0.7735 | 77.35% |
| CYP2C8 inhibition | + | 0.7152 | 71.52% |
| CYP inhibitory promiscuity | - | 0.8446 | 84.46% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8600 | 86.00% |
| Carcinogenicity (trinary) | Non-required | 0.5058 | 50.58% |
| Eye corrosion | - | 0.9800 | 98.00% |
| Eye irritation | - | 0.9098 | 90.98% |
| Skin irritation | - | 0.7579 | 75.79% |
| Skin corrosion | - | 0.9150 | 91.50% |
| Ames mutagenesis | - | 0.6600 | 66.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4255 | 42.55% |
| Micronuclear | + | 0.8900 | 89.00% |
| Hepatotoxicity | - | 0.5638 | 56.38% |
| skin sensitisation | - | 0.8377 | 83.77% |
| Respiratory toxicity | + | 0.8667 | 86.67% |
| Reproductive toxicity | + | 0.9556 | 95.56% |
| Mitochondrial toxicity | + | 0.9625 | 96.25% |
| Nephrotoxicity | - | 0.9060 | 90.60% |
| Acute Oral Toxicity (c) | III | 0.5739 | 57.39% |
| Estrogen receptor binding | + | 0.8027 | 80.27% |
| Androgen receptor binding | + | 0.7606 | 76.06% |
| Thyroid receptor binding | + | 0.5317 | 53.17% |
| Glucocorticoid receptor binding | + | 0.7215 | 72.15% |
| Aromatase binding | + | 0.6959 | 69.59% |
| PPAR gamma | + | 0.7612 | 76.12% |
| Honey bee toxicity | - | 0.6932 | 69.32% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | - | 0.5400 | 54.00% |
| Fish aquatic toxicity | + | 0.9897 | 98.97% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.57% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.24% | 96.09% |
| CHEMBL3137261 | O14744 | PRMT5/MEP50 complex | 97.41% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 97.19% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.29% | 97.09% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 96.24% | 80.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.10% | 91.11% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 94.02% | 95.93% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 93.23% | 89.34% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.74% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.49% | 99.23% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 92.48% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.11% | 86.33% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 91.72% | 94.78% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 91.29% | 92.86% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 90.78% | 91.03% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 90.31% | 95.69% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.47% | 89.00% |
| CHEMBL1871 | P10275 | Androgen Receptor | 89.18% | 96.43% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 87.70% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.34% | 94.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.19% | 90.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.17% | 95.56% |
| CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 86.83% | 96.67% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 86.65% | 97.36% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.33% | 100.00% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.93% | 96.61% |
| CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 84.80% | 95.48% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 83.99% | 92.50% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.20% | 93.00% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.75% | 99.18% |
| CHEMBL1977 | P11473 | Vitamin D receptor | 82.52% | 99.43% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 82.49% | 99.17% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.13% | 96.90% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.03% | 96.67% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.95% | 95.17% |
| CHEMBL5957 | P21589 | 5'-nucleotidase | 81.63% | 97.78% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.80% | 98.33% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.54% | 96.47% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.52% | 97.14% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.51% | 93.18% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.41% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73830896 |
| LOTUS | LTS0241954 |
| wikiData | Q105277284 |