[8-Methyl-6-(2-methylbut-2-enoyloxy)-8-azabicyclo[3.2.1]octan-3-yl] 6,15,22,28-tetramethyl-5,10,20,23-tetraoxo-8-phenyl-4,11,19,24-tetraoxa-15,28-diazahexacyclo[23.3.1.114,18.03,27.06,9.012,16]triacont-21-ene-7-carboxylate
Internal ID | 771b2e53-f862-43ac-8149-edbeb5dfb6b9 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Hexacarboxylic acids and derivatives |
IUPAC Name | [8-methyl-6-(2-methylbut-2-enoyloxy)-8-azabicyclo[3.2.1]octan-3-yl] 6,15,22,28-tetramethyl-5,10,20,23-tetraoxo-8-phenyl-4,11,19,24-tetraoxa-15,28-diazahexacyclo[23.3.1.114,18.03,27.06,9.012,16]triacont-21-ene-7-carboxylate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC2CC(CC1N2C)OC(=O)C3C(C4C3(C(=O)OC5CC6CC(CC5N6C)OC(=O)C(=CC(=O)OC7CC8CC(C(C7)N8C)OC4=O)C)C)C9=CC=CC=C9 |
SMILES (Isomeric) | CC=C(C)C(=O)OC1CC2CC(CC1N2C)OC(=O)C3C(C4C3(C(=O)OC5CC6CC(CC5N6C)OC(=O)C(=CC(=O)OC7CC8CC(C(C7)N8C)OC4=O)C)C)C9=CC=CC=C9 |
InChI | InChI=1S/C48H61N3O12/c1-8-24(2)43(53)61-36-18-28-17-32(23-34(36)50(28)6)60-45(55)41-40(26-12-10-9-11-13-26)42-46(56)62-37-19-27-15-30(21-33(37)49(27)5)58-39(52)14-25(3)44(54)59-31-16-29-20-38(35(22-31)51(29)7)63-47(57)48(41,42)4/h8-14,27-38,40-42H,15-23H2,1-7H3 |
InChI Key | SFYKGMNTMLMWQE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H61N3O12 |
Molecular Weight | 872.00 g/mol |
Exact Mass | 871.42552439 g/mol |
Topological Polar Surface Area (TPSA) | 168.00 Ų |
XlogP | 5.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.77% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.36% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.63% | 91.11% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 92.41% | 94.08% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.01% | 94.62% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.90% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.39% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 89.23% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.33% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.71% | 94.45% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 86.23% | 94.23% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.92% | 96.47% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.72% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.20% | 91.19% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.16% | 97.21% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 84.04% | 92.97% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.80% | 91.49% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.44% | 95.50% |
CHEMBL5028 | O14672 | ADAM10 | 82.75% | 97.50% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.02% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Schizanthus grahamii |
PubChem | 162985723 |
LOTUS | LTS0265504 |
wikiData | Q105252146 |