(3S)-3-acetyloxy-3-[(1R,2R,5R,6R,7R,10S,11S,14S)-11-(furan-3-yl)-5-(2-hydroxypropan-2-yl)-2,6,10-trimethyl-3,13-dioxo-12,15-dioxatetracyclo[8.5.0.01,14.02,7]pentadecan-6-yl]propanoic acid
Internal ID | 04b04ee1-2cb9-4e08-8d3b-4ac0f929b24f |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones |
IUPAC Name | (3S)-3-acetyloxy-3-[(1R,2R,5R,6R,7R,10S,11S,14S)-11-(furan-3-yl)-5-(2-hydroxypropan-2-yl)-2,6,10-trimethyl-3,13-dioxo-12,15-dioxatetracyclo[8.5.0.01,14.02,7]pentadecan-6-yl]propanoic acid |
SMILES (Canonical) | CC(=O)OC(CC(=O)O)C1(C2CCC3(C(OC(=O)C4C3(C2(C(=O)CC1C(C)(C)O)C)O4)C5=COC=C5)C)C |
SMILES (Isomeric) | CC(=O)O[C@@H](CC(=O)O)[C@@]1([C@H]2CC[C@]3([C@@H](OC(=O)[C@@H]4[C@@]3([C@@]2(C(=O)C[C@H]1C(C)(C)O)C)O4)C5=COC=C5)C)C |
InChI | InChI=1S/C28H36O10/c1-14(29)36-19(12-20(31)32)26(5)16-7-9-25(4)21(15-8-10-35-13-15)37-23(33)22-28(25,38-22)27(16,6)18(30)11-17(26)24(2,3)34/h8,10,13,16-17,19,21-22,34H,7,9,11-12H2,1-6H3,(H,31,32)/t16-,17+,19+,21+,22-,25+,26-,27+,28-/m1/s1 |
InChI Key | ZIKZPLSIAVHITA-WNGDLQANSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H36O10 |
Molecular Weight | 532.60 g/mol |
Exact Mass | 532.23084734 g/mol |
Topological Polar Surface Area (TPSA) | 153.00 Ų |
XlogP | 1.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.36% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.38% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 96.03% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.82% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.48% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.47% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.58% | 86.33% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.63% | 83.82% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 88.61% | 93.04% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.55% | 97.09% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 88.45% | 100.00% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 87.34% | 95.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.82% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.43% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.76% | 99.23% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.44% | 94.62% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.37% | 82.69% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.99% | 94.23% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.95% | 92.62% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.76% | 93.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.19% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Citrus × aurantium |
Citrus medica |
PubChem | 124708033 |
LOTUS | LTS0130055 |
wikiData | Q105376423 |