[3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl] 9-(hydroxymethyl)-6a,6b,9,12a-tetramethyl-2-methylidene-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Internal ID | e1107a9c-07a5-48e8-9e84-a71af4ca038b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 9-(hydroxymethyl)-6a,6b,9,12a-tetramethyl-2-methylidene-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
SMILES (Canonical) | CC12CCC(C(C1CCC3(C2CC=C4C3(CCC5(C4CC(=C)CC5)C(=O)OC6C(C(C(C(O6)CO)O)O)O)C)C)(C)CO)OC7C(C(C(C(O7)CO)O)O)O |
SMILES (Isomeric) | CC12CCC(C(C1CCC3(C2CC=C4C3(CCC5(C4CC(=C)CC5)C(=O)OC6C(C(C(C(O6)CO)O)O)O)C)C)(C)CO)OC7C(C(C(C(O7)CO)O)O)O |
InChI | InChI=1S/C41H64O14/c1-20-8-13-41(36(51)55-35-33(50)31(48)29(46)24(18-43)53-35)15-14-39(4)21(22(41)16-20)6-7-26-37(2)11-10-27(38(3,19-44)25(37)9-12-40(26,39)5)54-34-32(49)30(47)28(45)23(17-42)52-34/h6,22-35,42-50H,1,7-19H2,2-5H3 |
InChI Key | VPZKILYKYLHBKM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H64O14 |
Molecular Weight | 780.90 g/mol |
Exact Mass | 780.42960671 g/mol |
Topological Polar Surface Area (TPSA) | 236.00 Ų |
XlogP | 1.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.21% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.45% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 90.69% | 98.95% |
CHEMBL237 | P41145 | Kappa opioid receptor | 90.03% | 98.10% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.80% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.57% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.31% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.31% | 95.89% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.23% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.69% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.02% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 83.65% | 97.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.11% | 92.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.51% | 99.17% |
CHEMBL233 | P35372 | Mu opioid receptor | 81.52% | 97.93% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.34% | 93.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.75% | 94.33% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.52% | 95.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.25% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.07% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anredera baselloides |
PubChem | 14888774 |
LOTUS | LTS0213470 |
wikiData | Q105291123 |