[11-acetyloxy-1-[2-(2-acetyloxy-5-oxo-2H-furan-4-yl)ethenyl]-12-methyl-8-oxospiro[10-oxatricyclo[7.2.1.02,7]dodecane-6,2'-oxirane]-7-yl]methyl acetate
Internal ID | c27e4a7f-5e8b-488f-8824-ae63aaf300d4 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tetracarboxylic acids and derivatives |
IUPAC Name | [11-acetyloxy-1-[2-(2-acetyloxy-5-oxo-2H-furan-4-yl)ethenyl]-12-methyl-8-oxospiro[10-oxatricyclo[7.2.1.02,7]dodecane-6,2'-oxirane]-7-yl]methyl acetate |
SMILES (Canonical) | CC1C2C(=O)C3(C(C1(C(O2)OC(=O)C)C=CC4=CC(OC4=O)OC(=O)C)CCCC35CO5)COC(=O)C |
SMILES (Isomeric) | CC1C2C(=O)C3(C(C1(C(O2)OC(=O)C)C=CC4=CC(OC4=O)OC(=O)C)CCCC35CO5)COC(=O)C |
InChI | InChI=1S/C26H30O11/c1-13-20-21(30)26(12-32-14(2)27)18(6-5-8-24(26)11-33-24)25(13,23(37-20)35-16(4)29)9-7-17-10-19(34-15(3)28)36-22(17)31/h7,9-10,13,18-20,23H,5-6,8,11-12H2,1-4H3 |
InChI Key | RCPRWFKGQUABHY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H30O11 |
Molecular Weight | 518.50 g/mol |
Exact Mass | 518.17881177 g/mol |
Topological Polar Surface Area (TPSA) | 144.00 Ų |
XlogP | 1.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.06% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.09% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.29% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 91.45% | 98.95% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 90.54% | 94.80% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.15% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.13% | 95.56% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 87.70% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.57% | 89.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.29% | 97.25% |
CHEMBL5028 | O14672 | ADAM10 | 83.54% | 97.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.53% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.30% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.21% | 94.73% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.36% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Teucrium asiaticum |
PubChem | 163051046 |
LOTUS | LTS0086062 |
wikiData | Q105233855 |