5-(6-Hydroxy-5,5-dimethyl-2-methylidene-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl)-3-methylpentanoic acid
| Internal ID | 4e7ea45e-5e9a-485a-8f12-b916d20f7e00 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Carbocyclic fatty acids |
| IUPAC Name | 5-(6-hydroxy-5,5-dimethyl-2-methylidene-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl)-3-methylpentanoic acid |
| SMILES (Canonical) | CC(CCC1C2CCC(C(C2CCC1=C)(C)C)O)CC(=O)O |
| SMILES (Isomeric) | CC(CCC1C2CCC(C(C2CCC1=C)(C)C)O)CC(=O)O |
| InChI | InChI=1S/C19H32O3/c1-12(11-18(21)22)5-7-14-13(2)6-9-16-15(14)8-10-17(20)19(16,3)4/h12,14-17,20H,2,5-11H2,1,3-4H3,(H,21,22) |
| InChI Key | FRFQYWPTZOHVOQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.50 g/mol |
| Exact Mass | 308.23514488 g/mol |
| Topological Polar Surface Area (TPSA) | 57.50 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.81% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.21% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.46% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.27% | 91.11% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.98% | 96.47% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.67% | 93.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.72% | 94.45% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 85.21% | 90.24% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.40% | 91.19% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.40% | 95.89% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.25% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.35% | 90.71% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.00% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.90% | 99.17% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 82.52% | 89.05% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.88% | 98.33% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.68% | 96.38% |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 80.61% | 95.71% |
| CHEMBL3776 | Q14790 | Caspase-8 | 80.57% | 97.06% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.55% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Araucaria araucana |
| PubChem | 162880806 |
| LOTUS | LTS0083670 |
| wikiData | Q105000161 |