methyl (1S,4aR,4bS,7Z,8R,8aS,9R,10aR)-7-[2-[2-(dimethylamino)ethoxy]-2-oxoethylidene]-9-hydroxy-1,4a,8-trimethyl-10-oxo-2,3,4,4b,5,6,8,8a,9,10a-decahydrophenanthrene-1-carboxylate
Internal ID | 1a10b2df-7b98-450e-95bd-ceb047c467f5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | methyl (1S,4aR,4bS,7Z,8R,8aS,9R,10aR)-7-[2-[2-(dimethylamino)ethoxy]-2-oxoethylidene]-9-hydroxy-1,4a,8-trimethyl-10-oxo-2,3,4,4b,5,6,8,8a,9,10a-decahydrophenanthrene-1-carboxylate |
SMILES (Canonical) | CC1C2C(CCC1=CC(=O)OCCN(C)C)C3(CCCC(C3C(=O)C2O)(C)C(=O)OC)C |
SMILES (Isomeric) | C[C@@H]\1[C@H]2[C@H](CC/C1=C/C(=O)OCCN(C)C)[C@]3(CCC[C@]([C@@H]3C(=O)[C@@H]2O)(C)C(=O)OC)C |
InChI | InChI=1S/C25H39NO6/c1-15-16(14-18(27)32-13-12-26(4)5)8-9-17-19(15)20(28)21(29)22-24(17,2)10-7-11-25(22,3)23(30)31-6/h14-15,17,19-20,22,28H,7-13H2,1-6H3/b16-14-/t15-,17-,19-,20+,22+,24+,25-/m0/s1 |
InChI Key | ARSSWIWXJFPAGJ-BJNJORMFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H39NO6 |
Molecular Weight | 449.60 g/mol |
Exact Mass | 449.27773796 g/mol |
Topological Polar Surface Area (TPSA) | 93.10 Ų |
XlogP | 2.90 |
There are no found synonyms. |
![2D Structure of methyl (1S,4aR,4bS,7Z,8R,8aS,9R,10aR)-7-[2-[2-(dimethylamino)ethoxy]-2-oxoethylidene]-9-hydroxy-1,4a,8-trimethyl-10-oxo-2,3,4,4b,5,6,8,8a,9,10a-decahydrophenanthrene-1-carboxylate 2D Structure of methyl (1S,4aR,4bS,7Z,8R,8aS,9R,10aR)-7-[2-[2-(dimethylamino)ethoxy]-2-oxoethylidene]-9-hydroxy-1,4a,8-trimethyl-10-oxo-2,3,4,4b,5,6,8,8a,9,10a-decahydrophenanthrene-1-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/42b4ddb0-854c-11ee-9979-71a20d57324a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.46% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.71% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.89% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.68% | 91.11% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 93.44% | 90.08% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.21% | 95.93% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.04% | 91.19% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.66% | 97.25% |
CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 85.78% | 96.33% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 85.58% | 97.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.44% | 95.56% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.43% | 94.33% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 85.09% | 97.47% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.81% | 98.75% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.24% | 94.75% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.86% | 96.90% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.99% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.17% | 92.50% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.13% | 96.38% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.44% | 94.45% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.33% | 95.50% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.12% | 90.17% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.87% | 91.07% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 80.70% | 95.71% |
CHEMBL5028 | O14672 | ADAM10 | 80.57% | 97.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.43% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.34% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.20% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.16% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Erythrophleum suaveolens |
PubChem | 163057917 |
LOTUS | LTS0070319 |
wikiData | Q104917553 |