(2E,4E)-10-[(4S,4aS,6R,8S,8aR)-4-[[(2S)-2-hydroxy-2-[(2R,5R,6R)-2-hydroxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetyl]amino]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-yl]-9-oxodeca-2,4-dienoic acid
| Internal ID | 3c0bb5be-cb88-4bbf-8715-5b29b508d31a |
| Taxonomy | Organoheterocyclic compounds > Pyranodioxins |
| IUPAC Name | (2E,4E)-10-[(4S,4aS,6R,8S,8aR)-4-[[(2S)-2-hydroxy-2-[(2R,5R,6R)-2-hydroxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetyl]amino]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-yl]-9-oxodeca-2,4-dienoic acid |
| SMILES (Canonical) | CC1C(OC(CC1=C)(C(C(=O)NC2C3C(C(C(C(O3)CC(=O)CCCC=CC=CC(=O)O)(C)C)OC)OCO2)O)O)C |
| SMILES (Isomeric) | C[C@H]1[C@H](O[C@](CC1=C)([C@@H](C(=O)N[C@@H]2[C@@H]3[C@@H]([C@H](C([C@H](O3)CC(=O)CCC/C=C/C=C/C(=O)O)(C)C)OC)OCO2)O)O)C |
| InChI | InChI=1S/C30H45NO11/c1-17-15-30(37,42-19(3)18(17)2)25(35)27(36)31-28-24-23(39-16-40-28)26(38-6)29(4,5)21(41-24)14-20(32)12-10-8-7-9-11-13-22(33)34/h7,9,11,13,18-19,21,23-26,28,35,37H,1,8,10,12,14-16H2,2-6H3,(H,31,36)(H,33,34)/b9-7+,13-11+/t18-,19-,21-,23+,24+,25-,26-,28+,30-/m1/s1 |
| InChI Key | FEFNCJCBHKHTHJ-NJEZYTRHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H45NO11 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.29926125 g/mol |
| Topological Polar Surface Area (TPSA) | 170.00 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.11% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.53% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.27% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.44% | 99.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.85% | 91.19% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.26% | 94.45% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.04% | 92.88% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 87.58% | 89.50% |
| CHEMBL5028 | O14672 | ADAM10 | 86.27% | 97.50% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.16% | 86.33% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.75% | 91.24% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.59% | 98.75% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.84% | 95.50% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.37% | 96.90% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.30% | 92.62% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.25% | 94.73% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.11% | 95.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.80% | 96.00% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.67% | 97.28% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.12% | 100.00% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.93% | 95.71% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.90% | 94.33% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.81% | 96.47% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.45% | 98.95% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.02% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10817303 |
| LOTUS | LTS0070670 |
| wikiData | Q104993948 |