[(2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]decan-5-yl] (1S,4aS,7R,7aR)-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate
Internal ID | 6686362c-39ce-4f96-85da-6973f47fe18a |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | [(2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]decan-5-yl] (1S,4aS,7R,7aR)-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | CC1CCC2C1C(OC=C2C(=O)OC3C4CCOC(C4C5(C3O5)CO)OC6C(C(C(C(O6)CO)O)O)O)OC7C(C(C(C(O7)CO)O)O)O |
SMILES (Isomeric) | C[C@@H]1CC[C@H]2[C@@H]1[C@@H](OC=C2C(=O)O[C@H]3[C@@H]4CCO[C@H](C4[C@@]5([C@H]3O5)CO)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O |
InChI | InChI=1S/C31H46O18/c1-10-2-3-11-13(8-43-27(16(10)11)47-29-22(39)20(37)18(35)14(6-32)44-29)26(41)46-24-12-4-5-42-28(17(12)31(9-34)25(24)49-31)48-30-23(40)21(38)19(36)15(7-33)45-30/h8,10-12,14-25,27-30,32-40H,2-7,9H2,1H3/t10-,11-,12-,14-,15-,16-,17?,18-,19-,20+,21+,22-,23-,24+,25+,27+,28+,29+,30+,31-/m1/s1 |
InChI Key | JFUHCGVURJQGTM-KMYIXWBWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H46O18 |
Molecular Weight | 706.70 g/mol |
Exact Mass | 706.26841461 g/mol |
Topological Polar Surface Area (TPSA) | 276.00 Ų |
XlogP | -2.90 |
There are no found synonyms. |
![2D Structure of [(2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]decan-5-yl] (1S,4aS,7R,7aR)-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate 2D Structure of [(2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]decan-5-yl] (1S,4aS,7R,7aR)-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/423eca30-86b7-11ee-958d-23a3dc3f4180.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.35% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.96% | 96.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 97.88% | 96.61% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.09% | 85.14% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.94% | 83.82% |
CHEMBL2581 | P07339 | Cathepsin D | 94.91% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.72% | 97.09% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 93.79% | 94.80% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 90.77% | 92.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.53% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.13% | 92.94% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.86% | 89.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.67% | 96.21% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.75% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.67% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.65% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.43% | 97.25% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.22% | 95.93% |
CHEMBL5028 | O14672 | ADAM10 | 80.27% | 97.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.22% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Argylia radiata |
PubChem | 101637170 |
LOTUS | LTS0096705 |
wikiData | Q105127027 |