17-[1-(1-Ethyl-5,6,6-trimethyl-2,7,8-trioxabicyclo[3.2.1]octan-3-yl)ethyl]-7-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one
Internal ID | 51124554-5114-4314-8a76-e2989afbbc7a |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Pregnane steroids > Gluco/mineralocorticoids, progestogins and derivatives |
IUPAC Name | 17-[1-(1-ethyl-5,6,6-trimethyl-2,7,8-trioxabicyclo[3.2.1]octan-3-yl)ethyl]-7-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
SMILES (Canonical) | CCC12OC(CC(O1)(C(O2)(C)C)C)C(C)C3CCC4C3(CCC5C4C(CC6=CC(=O)C=CC56C)O)C |
SMILES (Isomeric) | CCC12OC(CC(O1)(C(O2)(C)C)C)C(C)C3CCC4C3(CCC5C4C(CC6=CC(=O)C=CC56C)O)C |
InChI | InChI=1S/C31H46O5/c1-8-31-34-25(17-30(7,36-31)27(3,4)35-31)18(2)21-9-10-22-26-23(12-14-29(21,22)6)28(5)13-11-20(32)15-19(28)16-24(26)33/h11,13,15,18,21-26,33H,8-10,12,14,16-17H2,1-7H3 |
InChI Key | VHCYZWIHUJLEIL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H46O5 |
Molecular Weight | 498.70 g/mol |
Exact Mass | 498.33452456 g/mol |
Topological Polar Surface Area (TPSA) | 65.00 Ų |
XlogP | 6.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.85% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.56% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.66% | 97.25% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.58% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 94.86% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 94.15% | 100.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.94% | 91.11% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.70% | 96.61% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.46% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.82% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.99% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.31% | 95.56% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 88.00% | 93.04% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.41% | 90.71% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.28% | 94.75% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.02% | 90.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.66% | 92.62% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.23% | 96.43% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.88% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.24% | 94.45% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.08% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Petunia integrifolia |
PubChem | 14542315 |
LOTUS | LTS0056935 |
wikiData | Q105286318 |