[(1R,2R,3R,4R,7S,8Z,12S,13S,14S,16S)-14-acetyloxy-16-formyl-2,3-dihydroxy-4,9,13,16-tetramethyl-5-oxo-6-oxatricyclo[11.3.0.03,7]hexadec-8-en-12-yl] acetate
| Internal ID | 34b6312c-d775-4762-9426-32cf9f8bdd74 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tricarboxylic acids and derivatives |
| IUPAC Name | [(1R,2R,3R,4R,7S,8Z,12S,13S,14S,16S)-14-acetyloxy-16-formyl-2,3-dihydroxy-4,9,13,16-tetramethyl-5-oxo-6-oxatricyclo[11.3.0.03,7]hexadec-8-en-12-yl] acetate |
| SMILES (Canonical) | CC1C(=O)OC2C1(C(C3C(CC(C3(C(CCC(=C2)C)OC(=O)C)C)OC(=O)C)(C)C=O)O)O |
| SMILES (Isomeric) | C[C@H]1C(=O)O[C@@H]/2[C@@]1([C@@H]([C@H]3[C@@](C[C@@H]([C@@]3([C@H](CC/C(=C2)/C)OC(=O)C)C)OC(=O)C)(C)C=O)O)O |
| InChI | InChI=1S/C24H34O9/c1-12-7-8-16(31-14(3)26)23(6)18(32-15(4)27)10-22(5,11-25)19(23)20(28)24(30)13(2)21(29)33-17(24)9-12/h9,11,13,16-20,28,30H,7-8,10H2,1-6H3/b12-9-/t13-,16-,17-,18-,19-,20+,22+,23-,24-/m0/s1 |
| InChI Key | NHZBQADRVDJGIZ-LVMCKPGRSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H34O9 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.22028266 g/mol |
| Topological Polar Surface Area (TPSA) | 136.00 Ų |
| XlogP | 0.80 |
| There are no found synonyms. |
![2D Structure of [(1R,2R,3R,4R,7S,8Z,12S,13S,14S,16S)-14-acetyloxy-16-formyl-2,3-dihydroxy-4,9,13,16-tetramethyl-5-oxo-6-oxatricyclo[11.3.0.03,7]hexadec-8-en-12-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/41eb15e0-85ff-11ee-a1b2-d12801df1e89.jpg "2D Structure of [(1R,2R,3R,4R,7S,8Z,12S,13S,14S,16S)-14-acetyloxy-16-formyl-2,3-dihydroxy-4,9,13,16-tetramethyl-5-oxo-6-oxatricyclo[11.3.0.03,7]hexadec-8-en-12-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.66% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.02% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.89% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.24% | 89.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.76% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.07% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.52% | 92.94% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.92% | 99.23% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.51% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.67% | 94.45% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.21% | 94.80% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.15% | 91.19% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.54% | 94.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.24% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Calocedrus formosana |
| Chrysothamnus viscidiflorus |
| Cryptomeria japonica |
| Juniperus chinensis |
| Phyllocladus trichomanoides |
| PubChem | 162860141 |
| LOTUS | LTS0247616 |
| wikiData | Q105032926 |