(2R,3R,4S,5S,6R)-2-[[(1R,4S,5S,8R,9R,12S,13S,16S,19R)-19-butoxy-8-[(E,2R)-6-hydroxy-6-methylhept-4-en-2-yl]-5,9,17,17-tetramethyl-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-16-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol
| Internal ID | f82633da-d8da-4c40-a912-b92c7d7583c4 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[[(1R,4S,5S,8R,9R,12S,13S,16S,19R)-19-butoxy-8-[(E,2R)-6-hydroxy-6-methylhept-4-en-2-yl]-5,9,17,17-tetramethyl-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-16-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES (Canonical) | CCCCOC1C23CCC4(C(CCC4(C2C=CC5(C3CCC(C5(C)C)OC6C(C(C(C(O6)CO)O)O)O)O1)C)C(C)CC=CC(C)(C)O)C |
| SMILES (Isomeric) | CCCCO[C@H]1[C@@]23CC[C@@]4([C@H](CC[C@]4([C@@H]2C=C[C@]5([C@H]3CC[C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O1)C)[C@H](C)C/C=C/C(C)(C)O)C |
| InChI | InChI=1S/C40H66O9/c1-9-10-22-46-34-39-21-20-37(7)25(24(2)12-11-17-35(3,4)45)15-18-38(37,8)27(39)16-19-40(49-34)28(39)13-14-29(36(40,5)6)48-33-32(44)31(43)30(42)26(23-41)47-33/h11,16-17,19,24-34,41-45H,9-10,12-15,18,20-23H2,1-8H3/b17-11+/t24-,25-,26-,27+,28+,29+,30-,31+,32-,33+,34-,37-,38+,39+,40-/m1/s1 |
| InChI Key | QRZTUYBYGGEHAN-URTMDPPUSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C40H66O9 |
| Molecular Weight | 690.90 g/mol |
| Exact Mass | 690.47068368 g/mol |
| Topological Polar Surface Area (TPSA) | 138.00 Ų |
| XlogP | 5.90 |
| There are no found synonyms. |
![2D Structure of (2R,3R,4S,5S,6R)-2-[[(1R,4S,5S,8R,9R,12S,13S,16S,19R)-19-butoxy-8-[(E,2R)-6-hydroxy-6-methylhept-4-en-2-yl]-5,9,17,17-tetramethyl-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-16-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/418363c0-83db-11ee-a23f-2306293e89e4.jpg "2D Structure of (2R,3R,4S,5S,6R)-2-[[(1R,4S,5S,8R,9R,12S,13S,16S,19R)-19-butoxy-8-[(E,2R)-6-hydroxy-6-methylhept-4-en-2-yl]-5,9,17,17-tetramethyl-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-16-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.21% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.86% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.40% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.08% | 98.95% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 96.40% | 97.79% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 95.78% | 92.86% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.71% | 96.61% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.29% | 97.09% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 94.91% | 97.29% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 94.49% | 92.88% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.49% | 95.89% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 93.23% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.52% | 93.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.63% | 99.17% |
| CHEMBL1977 | P11473 | Vitamin D receptor | 90.60% | 99.43% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.44% | 100.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.95% | 100.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.50% | 96.21% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 88.35% | 91.24% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 88.21% | 91.03% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.92% | 92.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.69% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.27% | 94.45% |
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 85.67% | 97.88% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.95% | 93.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.17% | 89.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.16% | 95.50% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.94% | 91.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.50% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.26% | 91.49% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.76% | 96.47% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 82.63% | 82.50% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.31% | 97.28% |
| CHEMBL4105838 | Q96GG9 | DCN1-like protein 1 | 81.75% | 95.00% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 81.67% | 85.31% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 81.66% | 97.47% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 81.60% | 92.32% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.48% | 97.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.16% | 100.00% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 80.87% | 87.45% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 80.31% | 95.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.27% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Momordica charantia |
| PubChem | 162922325 |
| LOTUS | LTS0053685 |
| wikiData | Q105226795 |