4,16-Dimethoxy-10-methyl-10-azatricyclo[11.4.0.02,7]heptadeca-1(13),2,4,6,14,16-hexaen-5-ol
| Internal ID | 68de4495-984d-4baa-be2a-d59970a67876 |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | 4,16-dimethoxy-10-methyl-10-azatricyclo[11.4.0.02,7]heptadeca-1(13),2,4,6,14,16-hexaen-5-ol |
| SMILES (Canonical) | CN1CCC2=C(C=C(C=C2)OC)C3=CC(=C(C=C3CC1)O)OC |
| SMILES (Isomeric) | CN1CCC2=C(C=C(C=C2)OC)C3=CC(=C(C=C3CC1)O)OC |
| InChI | InChI=1S/C19H23NO3/c1-20-8-6-13-4-5-15(22-2)11-16(13)17-12-19(23-3)18(21)10-14(17)7-9-20/h4-5,10-12,21H,6-9H2,1-3H3 |
| InChI Key | SMFDNCHPNJLRJG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.16779360 g/mol |
| Topological Polar Surface Area (TPSA) | 41.90 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
![2D Structure of 4,16-Dimethoxy-10-methyl-10-azatricyclo[11.4.0.02,7]heptadeca-1(13),2,4,6,14,16-hexaen-5-ol](https://plantaedb.com/storage/docs/compounds/2023/11/416-dimethoxy-10-methyl-10-azatricyclo1140027heptadeca-1132461416-hexaen-5-ol.jpg "2D Structure of 4,16-Dimethoxy-10-methyl-10-azatricyclo[11.4.0.02,7]heptadeca-1(13),2,4,6,14,16-hexaen-5-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.62% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 96.82% | 90.00% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 95.44% | 91.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.67% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.21% | 91.11% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 93.58% | 91.79% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.62% | 93.99% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.52% | 93.40% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.85% | 95.89% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.75% | 98.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.58% | 92.94% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.18% | 94.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.63% | 91.49% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.62% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.58% | 86.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.43% | 99.15% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.90% | 91.03% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.45% | 93.65% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 85.26% | 95.70% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.42% | 99.17% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 83.85% | 95.12% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 82.37% | 100.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.63% | 91.07% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 80.10% | 90.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cocculus laurifolius |
| PubChem | 85846863 |
| LOTUS | LTS0240089 |
| wikiData | Q105255871 |