3'-Hydroxy-4',5',5',6,10,12-hexamethyl-6-(3-oxobutyl)spiro[14-oxatetracyclo[9.3.2.01,10.02,7]hexadeca-2(7),3-diene-13,2'-oxolane]-5-one
| Internal ID | eddd2614-a071-4005-8f2b-aa4b73d00e2a |
| Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
| IUPAC Name | 3'-hydroxy-4',5',5',6,10,12-hexamethyl-6-(3-oxobutyl)spiro[14-oxatetracyclo[9.3.2.01,10.02,7]hexadeca-2(7),3-diene-13,2'-oxolane]-5-one |
| SMILES (Canonical) | CC1C2CCC3(C2(CCC4=C3C=CC(=O)C4(C)CCC(=O)C)C)OC15C(C(C(O5)(C)C)C)O |
| SMILES (Isomeric) | CC1C2CCC3(C2(CCC4=C3C=CC(=O)C4(C)CCC(=O)C)C)OC15C(C(C(O5)(C)C)C)O |
| InChI | InChI=1S/C28H40O5/c1-16(29)10-13-25(6)20-11-14-26(7)19-12-15-27(26,21(20)8-9-22(25)30)33-28(17(19)2)23(31)18(3)24(4,5)32-28/h8-9,17-19,23,31H,10-15H2,1-7H3 |
| InChI Key | JASZNDQUKJVDQJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H40O5 |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.28757437 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | 2.80 |
| There are no found synonyms. |
![2D Structure of 3'-Hydroxy-4',5',5',6,10,12-hexamethyl-6-(3-oxobutyl)spiro[14-oxatetracyclo[9.3.2.01,10.02,7]hexadeca-2(7),3-diene-13,2'-oxolane]-5-one](https://plantaedb.com/storage/docs/compounds/2023/11/4147fa40-8560-11ee-8da7-2f37eb6dec92.jpg "2D Structure of 3'-Hydroxy-4',5',5',6,10,12-hexamethyl-6-(3-oxobutyl)spiro[14-oxatetracyclo[9.3.2.01,10.02,7]hexadeca-2(7),3-diene-13,2'-oxolane]-5-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.12% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.58% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.63% | 98.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.08% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.61% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.61% | 97.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.93% | 90.71% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.84% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.32% | 85.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.01% | 99.23% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.99% | 82.69% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.79% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.27% | 92.94% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.52% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 57406064 |
| LOTUS | LTS0130156 |
| wikiData | Q104914840 |