(2R,3R,4S,5S,6R)-2-[[(3S,5S,6S,8R,9R,10R,12R,13R,14R,17S)-17-[(2S,5R)-5,6-dihydroxy-6-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-2-yl]-3,12-dihydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 9de5f26e-aaef-4497-afcc-95b75cc54c17 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[[(3S,5S,6S,8R,9R,10R,12R,13R,14R,17S)-17-[(2S,5R)-5,6-dihydroxy-6-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-2-yl]-3,12-dihydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1(C(CCC2(C1C(CC3(C2CC(C4C3(CCC4C(C)(CCC(C(C)(C)O)O)OC5C(C(C(C(O5)CO)O)O)O)C)O)C)OC6C(C(C(C(O6)CO)O)O)O)C)O)C |
SMILES (Isomeric) | C[C@]12CC[C@@H](C([C@H]1[C@H](C[C@@]3([C@@H]2C[C@H]([C@H]4[C@]3(CC[C@@H]4[C@](C)(CC[C@H](C(C)(C)O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C)O)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)(C)C)O |
InChI | InChI=1S/C42H74O16/c1-37(2)25(46)10-12-39(5)24-15-20(45)27-19(42(8,14-11-26(47)38(3,4)54)58-36-33(53)31(51)29(49)23(18-44)57-36)9-13-40(27,6)41(24,7)16-21(34(37)39)55-35-32(52)30(50)28(48)22(17-43)56-35/h19-36,43-54H,9-18H2,1-8H3/t19-,20+,21-,22+,23+,24+,25-,26+,27-,28+,29+,30-,31-,32+,33+,34+,35+,36-,39+,40+,41+,42-/m0/s1 |
InChI Key | YFXPRCDUBFSHJY-RNUJZAHXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C42H74O16 |
Molecular Weight | 835.00 g/mol |
Exact Mass | 834.49768627 g/mol |
Topological Polar Surface Area (TPSA) | 280.00 Ų |
XlogP | 0.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.82% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.70% | 91.11% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 97.03% | 96.61% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.64% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.30% | 96.09% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 92.16% | 97.79% |
CHEMBL2581 | P07339 | Cathepsin D | 91.45% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.99% | 95.89% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 89.24% | 100.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.86% | 85.14% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.67% | 97.14% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 87.45% | 96.21% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.26% | 92.94% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.66% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.42% | 100.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 86.29% | 95.93% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.05% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.03% | 94.45% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.46% | 95.50% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.35% | 92.86% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 85.31% | 90.24% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 84.24% | 92.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.75% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.72% | 95.89% |
CHEMBL4105786 | P41182 | B-cell lymphoma 6 protein | 83.53% | 92.86% |
CHEMBL237 | P41145 | Kappa opioid receptor | 83.18% | 98.10% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.91% | 95.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Panax notoginseng |
PubChem | 162897249 |
LOTUS | LTS0104522 |
wikiData | Q105347889 |