(1S,3R,8S,11S,12S,15R,16R)-7,7,12,16-tetramethyl-15-[(2R)-6-methylhept-5-en-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-one
Internal ID | eea9c204-80ce-4fec-ba23-3e65bbaa740f |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cycloartanols and derivatives |
IUPAC Name | (1S,3R,8S,11S,12S,15R,16R)-7,7,12,16-tetramethyl-15-[(2R)-6-methylhept-5-en-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-one |
SMILES (Canonical) | CC(CCC=C(C)C)C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(=O)C5(C)C)C)C |
SMILES (Isomeric) | C[C@H](CCC=C(C)C)[C@H]1CC[C@@]2([C@@]1(CC[C@]34[C@H]2CC[C@H]5[C@]3(C4)CCC(=O)C5(C)C)C)C |
InChI | InChI=1S/C30H48O/c1-20(2)9-8-10-21(3)22-13-15-28(7)24-12-11-23-26(4,5)25(31)14-16-29(23)19-30(24,29)18-17-27(22,28)6/h9,21-24H,8,10-19H2,1-7H3/t21-,22-,23-,24+,27-,28+,29-,30+/m1/s1 |
InChI Key | NAJCQAAOHKVCES-GSFUUBGPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H48O |
Molecular Weight | 424.70 g/mol |
Exact Mass | 424.370516150 g/mol |
Topological Polar Surface Area (TPSA) | 17.10 Ų |
XlogP | 9.50 |
There are no found synonyms. |
![2D Structure of (1S,3R,8S,11S,12S,15R,16R)-7,7,12,16-tetramethyl-15-[(2R)-6-methylhept-5-en-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-one 2D Structure of (1S,3R,8S,11S,12S,15R,16R)-7,7,12,16-tetramethyl-15-[(2R)-6-methylhept-5-en-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/413504d0-86ac-11ee-846d-95fb1b3f2841.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.13% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.58% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.81% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.69% | 94.45% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.39% | 94.75% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.43% | 96.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.35% | 90.71% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.03% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.94% | 95.56% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 85.79% | 90.08% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.38% | 93.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.64% | 97.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.59% | 82.69% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.11% | 93.56% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.56% | 97.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.14% | 92.62% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.04% | 89.34% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.02% | 100.00% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 80.88% | 95.69% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.82% | 95.89% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.50% | 94.78% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 80.41% | 95.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.32% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus nobilis |
PubChem | 163000436 |
LOTUS | LTS0069425 |
wikiData | Q105176348 |