4H-1-Benzopyran-4-one, 6-alpha-L-arabinopyranosyl-8-beta-D-galactopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)-
| Internal ID | 3bbc8076-6cc3-41cd-8a3a-e486a610199c |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides > Flavonoid 8-C-glycosides |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-6-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]chromen-4-one |
| SMILES (Canonical) | C1C(C(C(C(O1)C2=C(C(=C3C(=C2O)C(=O)C=C(O3)C4=CC=C(C=C4)O)C5C(C(C(C(O5)CO)O)O)O)O)O)O)O |
| SMILES (Isomeric) | C1[C@@H]([C@@H]([C@H]([C@@H](O1)C2=C(C(=C3C(=C2O)C(=O)C=C(O3)C4=CC=C(C=C4)O)[C@H]5[C@@H]([C@H]([C@H]([C@H](O5)CO)O)O)O)O)O)O)O |
| InChI | InChI=1S/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)16-20(34)15(25-22(36)17(31)11(30)7-38-25)19(33)14-10(29)5-12(39-24(14)16)8-1-3-9(28)4-2-8/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13+,17-,18-,21-,22+,23+,25-,26-/m0/s1 |
| InChI Key | OVMFOVNOXASTPA-RDMDIROFSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H28O14 |
| Molecular Weight | 564.50 g/mol |
| Exact Mass | 564.14790556 g/mol |
| Topological Polar Surface Area (TPSA) | 247.00 Ų |
| XlogP | -2.20 |
| Atomic LogP (AlogP) | -1.75 |
| H-Bond Acceptor | 14 |
| H-Bond Donor | 10 |
| Rotatable Bonds | 4 |
| 73543-87-0 |
| 4H-1-Benzopyran-4-one, 6-alpha-L-arabinopyranosyl-8-beta-D-galactopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)- |
| orb1680207 |
| SCHEMBL6910315 |
| apigenin-6-arbinose 8-galactoside |
| DTXSID201113214 |
| AKOS040763546 |
| 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-6-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]-4H-1-benzopyran-4-one |
| 6-I+/--L-Arabinopyranosyl-8-I(2)-D-galactopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6857 | 68.57% |
| Caco-2 | - | 0.9176 | 91.76% |
| Blood Brain Barrier | - | 0.6250 | 62.50% |
| Human oral bioavailability | - | 0.7714 | 77.14% |
| Subcellular localzation | Mitochondria | 0.4570 | 45.70% |
| OATP2B1 inhibitior | - | 0.5524 | 55.24% |
| OATP1B1 inhibitior | + | 0.7874 | 78.74% |
| OATP1B3 inhibitior | + | 0.9676 | 96.76% |
| MATE1 inhibitior | - | 0.8200 | 82.00% |
| OCT2 inhibitior | - | 0.8500 | 85.00% |
| BSEP inhibitior | + | 0.6971 | 69.71% |
| P-glycoprotein inhibitior | - | 0.5976 | 59.76% |
| P-glycoprotein substrate | - | 0.6583 | 65.83% |
| CYP3A4 substrate | + | 0.6172 | 61.72% |
| CYP2C9 substrate | - | 0.6194 | 61.94% |
| CYP2D6 substrate | - | 0.8416 | 84.16% |
| CYP3A4 inhibition | - | 0.8741 | 87.41% |
| CYP2C9 inhibition | - | 0.9567 | 95.67% |
| CYP2C19 inhibition | - | 0.9398 | 93.98% |
| CYP2D6 inhibition | - | 0.9294 | 92.94% |
| CYP1A2 inhibition | - | 0.9102 | 91.02% |
| CYP2C8 inhibition | + | 0.6484 | 64.84% |
| CYP inhibitory promiscuity | - | 0.8877 | 88.77% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.9800 | 98.00% |
| Carcinogenicity (trinary) | Non-required | 0.6898 | 68.98% |
| Eye corrosion | - | 0.9945 | 99.45% |
| Eye irritation | - | 0.8894 | 88.94% |
| Skin irritation | - | 0.7949 | 79.49% |
| Skin corrosion | - | 0.9607 | 96.07% |
| Ames mutagenesis | + | 0.6666 | 66.66% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7741 | 77.41% |
| Micronuclear | + | 0.6459 | 64.59% |
| Hepatotoxicity | - | 0.7196 | 71.96% |
| skin sensitisation | - | 0.8677 | 86.77% |
| Respiratory toxicity | + | 0.6667 | 66.67% |
| Reproductive toxicity | + | 0.8444 | 84.44% |
| Mitochondrial toxicity | + | 0.7000 | 70.00% |
| Nephrotoxicity | - | 0.8903 | 89.03% |
| Acute Oral Toxicity (c) | III | 0.4064 | 40.64% |
| Estrogen receptor binding | + | 0.7545 | 75.45% |
| Androgen receptor binding | + | 0.7345 | 73.45% |
| Thyroid receptor binding | - | 0.5106 | 51.06% |
| Glucocorticoid receptor binding | - | 0.5000 | 50.00% |
| Aromatase binding | + | 0.6152 | 61.52% |
| PPAR gamma | + | 0.7230 | 72.30% |
| Honey bee toxicity | - | 0.7506 | 75.06% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | - | 0.6200 | 62.00% |
| Fish aquatic toxicity | - | 0.4350 | 43.50% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.64% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.55% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.09% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.74% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.26% | 97.09% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 90.40% | 89.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.00% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.03% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.83% | 94.73% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.44% | 90.71% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 86.09% | 95.83% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.37% | 99.15% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.10% | 94.45% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 83.88% | 85.11% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.84% | 86.92% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.49% | 93.10% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.35% | 91.71% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 82.98% | 94.45% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 82.77% | 95.64% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 81.33% | 80.33% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.17% | 96.21% |
| PubChem | 5322047 |
| LOTUS | LTS0259679 |
| wikiData | Q105200818 |