(6R,7S,8S)-8-(4-hydroxy-3,5-dimethoxyphenyl)-6,7-bis(hydroxymethyl)-1,3-dimethoxy-5,6,7,8-tetrahydronaphthalen-2-ol
Internal ID | 7f624fdd-06d6-45bc-99c7-5baa5fd1fdb3 |
Taxonomy | Lignans, neolignans and related compounds > Aryltetralin lignans > 9,9p-dihydroxyaryltetralin lignans |
IUPAC Name | (6R,7S,8S)-8-(4-hydroxy-3,5-dimethoxyphenyl)-6,7-bis(hydroxymethyl)-1,3-dimethoxy-5,6,7,8-tetrahydronaphthalen-2-ol |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C2C(C(CC3=CC(=C(C(=C23)OC)O)OC)CO)CO |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)[C@@H]2[C@@H]([C@@H](CC3=CC(=C(C(=C23)OC)O)OC)CO)CO |
InChI | InChI=1S/C22H28O8/c1-27-15-7-12(8-16(28-2)20(15)25)18-14(10-24)13(9-23)5-11-6-17(29-3)21(26)22(30-4)19(11)18/h6-8,13-14,18,23-26H,5,9-10H2,1-4H3/t13-,14+,18+/m0/s1 |
InChI Key | ZDVZKBOFCHOPLM-PMUMKWKESA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H28O8 |
Molecular Weight | 420.50 g/mol |
Exact Mass | 420.17841785 g/mol |
Topological Polar Surface Area (TPSA) | 118.00 Ų |
XlogP | 2.00 |
There are no found synonyms. |
![2D Structure of (6R,7S,8S)-8-(4-hydroxy-3,5-dimethoxyphenyl)-6,7-bis(hydroxymethyl)-1,3-dimethoxy-5,6,7,8-tetrahydronaphthalen-2-ol 2D Structure of (6R,7S,8S)-8-(4-hydroxy-3,5-dimethoxyphenyl)-6,7-bis(hydroxymethyl)-1,3-dimethoxy-5,6,7,8-tetrahydronaphthalen-2-ol](https://plantaedb.com/storage/docs/compounds/2023/11/411de240-883a-11ee-a4e3-cb3b4ed445ba.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.85% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.89% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.62% | 99.17% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.72% | 92.94% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.04% | 97.09% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.98% | 89.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.24% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.52% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.62% | 92.62% |
CHEMBL2581 | P07339 | Cathepsin D | 83.11% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.08% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.20% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.34% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Neolitsea acuminatissima |
Vitex negundo |
PubChem | 102317783 |
LOTUS | LTS0128288 |
wikiData | Q105372776 |