2-[[6-[2-[1-(3,16-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethoxy]-5-hydroxy-4-methoxy-6-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | d6a184fc-ae61-405a-9c09-393f18a4d732 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | 2-[[6-[2-[1-(3,16-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethoxy]-5-hydroxy-4-methoxy-6-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC(C)C2C(CC3C2(CCC4C3CC=C5C4(CCC(C5)O)C)C)O)OC6C(C(C(C(O6)COC7C(C(C(C(O7)CO)O)O)O)O)O)O)OC)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC(C)C2C(CC3C2(CCC4C3CC=C5C4(CCC(C5)O)C)C)O)OC6C(C(C(C(O6)COC7C(C(C(C(O7)CO)O)O)O)O)O)O)OC)O |
InChI | InChI=1S/C40H66O17/c1-16(26-23(43)13-22-20-7-6-18-12-19(42)8-10-39(18,3)21(20)9-11-40(22,26)4)53-38-35(34(51-5)27(44)17(2)54-38)57-37-33(50)31(48)29(46)25(56-37)15-52-36-32(49)30(47)28(45)24(14-41)55-36/h6,16-17,19-38,41-50H,7-15H2,1-5H3 |
InChI Key | FJAQGHOBXXUAQL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H66O17 |
Molecular Weight | 818.90 g/mol |
Exact Mass | 818.43000063 g/mol |
Topological Polar Surface Area (TPSA) | 267.00 Ų |
XlogP | -1.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.40% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.35% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.59% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.24% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 92.61% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.03% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.02% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.83% | 89.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 87.73% | 96.43% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 87.38% | 89.05% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.38% | 95.89% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.82% | 93.04% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.31% | 86.33% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.87% | 94.75% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.93% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.90% | 94.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.91% | 97.25% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.40% | 97.79% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.09% | 94.45% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.62% | 93.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.30% | 97.36% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.89% | 95.83% |
CHEMBL5028 | O14672 | ADAM10 | 80.76% | 97.50% |
CHEMBL237 | P41145 | Kappa opioid receptor | 80.61% | 98.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Periploca sepium |
PubChem | 14018739 |
LOTUS | LTS0209028 |
wikiData | Q104995958 |