[(3aS,6R,10S,11R,11aS)-10-hydroxy-6,10-dimethyl-3-methylidene-2,5-dioxo-3a,4,6,7,8,9,11,11a-octahydrocyclodeca[b]furan-11-yl] (E)-2-methylbut-2-enoate
Internal ID | 00cffe87-e3e4-4ca9-b6e5-f1ccef5561b8 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Germacranolides and derivatives |
IUPAC Name | [(3aS,6R,10S,11R,11aS)-10-hydroxy-6,10-dimethyl-3-methylidene-2,5-dioxo-3a,4,6,7,8,9,11,11a-octahydrocyclodeca[b]furan-11-yl] (E)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1C2C(CC(=O)C(CCCC1(C)O)C)C(=C)C(=O)O2 |
SMILES (Isomeric) | C/C=C(\C)/C(=O)O[C@@H]1[C@@H]2[C@@H](CC(=O)[C@@H](CCC[C@]1(C)O)C)C(=C)C(=O)O2 |
InChI | InChI=1S/C20H28O6/c1-6-11(2)18(22)26-17-16-14(13(4)19(23)25-16)10-15(21)12(3)8-7-9-20(17,5)24/h6,12,14,16-17,24H,4,7-10H2,1-3,5H3/b11-6+/t12-,14+,16+,17-,20+/m1/s1 |
InChI Key | FPXHAHZGQPOGBX-KLOJIELXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H28O6 |
Molecular Weight | 364.40 g/mol |
Exact Mass | 364.18858861 g/mol |
Topological Polar Surface Area (TPSA) | 89.90 Ų |
XlogP | 2.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.70% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.70% | 97.25% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 93.22% | 92.94% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.24% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.65% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.09% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.09% | 86.33% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 87.46% | 97.05% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 87.38% | 91.24% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.52% | 93.03% |
CHEMBL2581 | P07339 | Cathepsin D | 86.21% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.83% | 97.09% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.96% | 91.07% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.66% | 97.79% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.31% | 93.04% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.67% | 93.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.37% | 91.19% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.10% | 95.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.80% | 95.89% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 80.47% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.47% | 96.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.30% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Carpesium glossophyllum |
PubChem | 10832599 |
LOTUS | LTS0131830 |
wikiData | Q104999446 |