2-[(3R,6S,9S,10R,13R,16S)-6-(3-amino-3-oxopropyl)-9-[[(2S)-2-[[(2S)-2-[[(2R)-2-[[(2S)-2-[[(2R)-2-[[(2S)-1-[(2R,3R)-3-(4-bromophenyl)-2-[[(2R)-2-formamidopropanoyl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carbonyl]amino]-3,3-dimethylbutanoyl]amino]-3,3-dimethylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfopropanoyl]amino]-7,10-dimethyl-2,5,8,12,15-pentaoxo-3-propan-2-yl-11-oxa-1,4,7,14-tetrazabicyclo[14.3.0]nonadecan-13-yl]acetic acid
| Internal ID | b9273e6f-87e1-4a28-bb5b-1e0268014981 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | 2-[(3R,6S,9S,10R,13R,16S)-6-(3-amino-3-oxopropyl)-9-[[(2S)-2-[[(2S)-2-[[(2R)-2-[[(2S)-2-[[(2R)-2-[[(2S)-1-[(2R,3R)-3-(4-bromophenyl)-2-[[(2R)-2-formamidopropanoyl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carbonyl]amino]-3,3-dimethylbutanoyl]amino]-3,3-dimethylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfopropanoyl]amino]-7,10-dimethyl-2,5,8,12,15-pentaoxo-3-propan-2-yl-11-oxa-1,4,7,14-tetrazabicyclo[14.3.0]nonadecan-13-yl]acetic acid |
| SMILES (Canonical) | CCC(C)(C)C(C(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)NC(CCCN=C(N)N)C(=O)NC(CS(=O)(=O)O)C(=O)NC3C(OC(=O)C(NC(=O)C4CCCN4C(=O)C(NC(=O)C(N(C3=O)C)CCC(=O)N)C(C)C)CC(=O)O)C)NC(=O)C(C(C)(C)C)NC(=O)C5CCCN5C(=O)C(C(C6=CC=C(C=C6)Br)O)NC(=O)C(C)NC=O |
| SMILES (Isomeric) | CCC(C)(C)[C@@H](C(=O)N[C@H](CC1=CNC2=CC=CC=C21)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](CS(=O)(=O)O)C(=O)N[C@H]3[C@H](OC(=O)[C@H](NC(=O)[C@@H]4CCCN4C(=O)[C@H](NC(=O)[C@@H](N(C3=O)C)CCC(=O)N)C(C)C)CC(=O)O)C)NC(=O)[C@@H](C(C)(C)C)NC(=O)[C@@H]5CCCN5C(=O)[C@@H]([C@@H](C6=CC=C(C=C6)Br)O)NC(=O)[C@@H](C)NC=O |
| InChI | InChI=1S/C75H109BrN18O22S/c1-12-75(9,10)59(91-67(107)58(74(6,7)8)90-66(106)51-22-17-31-94(51)71(111)56(89-60(100)38(4)82-36-95)57(99)40-23-25-42(76)26-24-40)68(108)84-46(32-41-34-81-44-19-14-13-18-43(41)44)62(102)83-45(20-15-29-80-73(78)79)61(101)86-48(35-117(113,114)115)63(103)88-55-39(5)116-72(112)47(33-53(97)98)85-65(105)50-21-16-30-93(50)70(110)54(37(2)3)87-64(104)49(27-28-52(77)96)92(11)69(55)109/h13-14,18-19,23-26,34,36-39,45-51,54-59,81,99H,12,15-17,20-22,27-33,35H2,1-11H3,(H2,77,96)(H,82,95)(H,83,102)(H,84,108)(H,85,105)(H,86,101)(H,87,104)(H,88,103)(H,89,100)(H,90,106)(H,91,107)(H,97,98)(H4,78,79,80)(H,113,114,115)/t38-,39-,45+,46-,47-,48-,49+,50+,51+,54-,55+,56-,57-,58+,59-/m1/s1 |
| InChI Key | GUGALNGMVNRENE-RENFRXRISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C75H109BrN18O22S |
| Molecular Weight | 1726.70 g/mol |
| Exact Mass | 1724.68679 g/mol |
| Topological Polar Surface Area (TPSA) | 622.00 Ų |
| XlogP | -0.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 99.98% | 96.31% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.86% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.40% | 96.09% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.35% | 97.64% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 99.34% | 98.33% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 99.31% | 94.66% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 99.29% | 95.56% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 99.25% | 92.12% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 99.17% | 96.76% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 98.93% | 90.08% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.30% | 91.11% |
| CHEMBL3837 | P07711 | Cathepsin L | 97.71% | 96.61% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 97.61% | 99.23% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 97.50% | 88.42% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 97.11% | 95.38% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 97.05% | 82.38% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 97.04% | 95.92% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.81% | 85.14% |
| CHEMBL4644 | P41968 | Melanocortin receptor 3 | 95.84% | 99.52% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.60% | 97.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 95.39% | 96.47% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.38% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 95.29% | 99.23% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 95.20% | 97.31% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.20% | 93.56% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 94.90% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.89% | 94.75% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 94.88% | 97.56% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 94.22% | 95.00% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 94.19% | 92.97% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.08% | 95.89% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 93.77% | 97.23% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 93.45% | 98.24% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 93.44% | 90.93% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 93.38% | 88.56% |
| CHEMBL5028 | O14672 | ADAM10 | 92.68% | 97.50% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 92.37% | 89.62% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.98% | 96.90% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 91.00% | 93.03% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 90.80% | 91.81% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 90.58% | 94.50% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 90.52% | 100.00% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 89.96% | 96.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.43% | 99.17% |
| CHEMBL4801 | P29466 | Caspase-1 | 89.24% | 96.85% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 89.00% | 97.29% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.77% | 98.75% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.54% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.74% | 97.14% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 87.69% | 95.69% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 87.50% | 89.63% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 87.35% | 95.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.31% | 97.25% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.26% | 96.00% |
| CHEMBL4393 | P39900 | Matrix metalloproteinase 12 | 86.11% | 92.22% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 85.55% | 92.38% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 85.05% | 96.11% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 84.93% | 97.00% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 84.74% | 95.56% |
| CHEMBL205 | P00918 | Carbonic anhydrase II | 83.11% | 98.44% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.85% | 98.05% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.01% | 99.18% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 81.21% | 82.50% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 80.57% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.35% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162852868 |
| LOTUS | LTS0127365 |
| wikiData | Q105020110 |